Feedback

(5S)-5-amino-3-oxohexanoate

Properties
MNX_IDMNXM2894
formulaC6H11NO3
charge0
mass145.15648
referencechebi:58523
Image of MNXM2894
InChIKeyFAASBXNEOGMQHS-BYPYZUCNSA-N
InChIInChI=1S/C6H11NO3/c1-4(7)2-5(8)3-6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1
SMILESC[C@H]([NH3+])CC(=O)CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-159 (S)-5-amino-3-oxohexanoate
(S)-3-keto-5-aminohexanoate
hmdb:HMDB0012131 (S)-5-Amino-3-oxohexanoate
(5S)-5-amino-3-oxohexanoic acid
(S)-5-amino-3-Oxohexanoic acid
(S)-5-amino-3-oxo-Hexanoate
(S)-5-amino-3-oxo-Hexanoic acid
(S)-5-amino-3-oxohexanoic acid
3-keto-5-Aminohexanoate
3-keto-5-Aminohexanoic acid
5-amino-3-Oxohexanoate
5-amino-3-Oxohexanoic acid
chebi:27713 (5S)-5-amino-3-oxohexanoic acid
(S)-5-Amino-3-oxohexanoate
(S)-5-amino-3-oxohexanoate
chebi:58523 (5S)-5-amino-3-oxohexanoate
(5S)-5-amino-3-oxohexanoic acid zwitterion
(5S)-5-ammonio-3-oxohexanoate
lipidmaps:LMFA01060173 3-oxo-5S-amino-hexanoic acid
(5S)-5-Amino-3-oxohexanoic acid
3-oxo-5S-amino-hexanoic acid
chebi:11054
chebi:18761
chebi:408
hmdb:HMDB12131
keggC:M_C03656
seedM:M_cpd02294
secondary/obsolete/fantasy identifier
keggC:C03656 (S)-5-Amino-3-oxohexanoic acid
(S)-5-Amino-3-oxohexanoate
seedM:cpd02294 (S)-5-Amino-3-oxohexanoate
(3)-3-keto-5-aminohexanoate
(S)-5-Amino-3-oxohexanoic acid
(S)-5-amino-3-oxohexanoate
3-keto-5-aminohexanoate