This is version 4.2 of MetaNetX/MNXref
 Feedback

glycine

PropertiesImageOccurences in reactions
MNX_IDMNXM29Image of MNXM29
#reac
in my sandbox 0
in MNXref (generic)572
in models (compartimentalized) 356
formulaC2H5NO2
charge0
mass75.06664
referencechebi:57305
InChIKeyDHMQDGOQFOQNFH-UHFFFAOYSA-N
InChIInChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
SMILES[NH3+]CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113545
reactomeM:R-ALL-113545
reactome:R-ALL-159549
reactomeM:R-ALL-159549
reactome:R-ALL-193446
reactomeM:R-ALL-193446
reactome:R-ALL-266029
reactomeM:R-ALL-266029
reactome:R-ALL-29424
reactomeM:R-ALL-29424
reactome:R-ALL-428557
reactomeM:R-ALL-428557
CHEBI:57305
chebi:57305
glycine
2-azaniumylacetate
glycine zwitterion
bigg.metabolite:gly
biggM:gly
envipath:...0e48c8dcbb87
envipathM:...0e48c8dcbb87
Glycine
kegg.drug:D00011
keggD:D00011
Glycine (JP17/USP)
hmdb:HMDB0000123 Glycine
2-Aminoacetate
2-Aminoacetic acid
2-aminoacetic acid
Acid, aminoacetic
Aciport
Aminoacetate
Aminoacetic acid
Aminoessigsaeure
Aminoethanoate
Aminoethanoic acid
Calcium salt glycine
Cobalt salt glycine
Copper salt glycine
G
Glicoamin
Gly
Glycin
Glycine carbonate (1:1), monosodium salt
Glycine carbonate (2:1), monolithium salt
Glycine carbonate (2:1), monopotassium salt
Glycine carbonate (2:1), monosodium salt
Glycine hydrochloride
Glycine hydrochloride (2:1)
Glycine phosphate
Glycine phosphate (1:1)
Glycine sulfate (3:1)
Glycine, calcium salt
Glycine, calcium salt (2:1)
Glycine, cobalt salt
Glycine, copper salt
Glycine, monoammonium salt
Glycine, monopotasssium salt
Glycine, monosodium salt
Glycine, sodium hydrogen carbonate
Glycocoll
Glycolixir
Glycosthene
Glykokoll
Glyzin
Gyn-hydralin
H2N-CH2-COOH
Hgly
Hydrochloride, glycine
Leimzucker
Monoammonium salt glycine
Monopotasssium salt glycine
Monosodium salt glycine
Padil
Phosphate, glycine
Salt glycine, monoammonium
Salt glycine, monosodium
amino-Acetate
amino-Acetic acid
glycine
sabiork.compound:66
sabiorkM:66
kegg.compound:C00037
keggC:C00037
Glycine
Aminoacetic acid
Gly
seed.compound:cpd00033
seedM:cpd00033
Glycine
Aminoacetic acid
Gly
aminoacetic acid
gly
glycine
envipath:...858bd29cddaa
envipathM:...858bd29cddaa
compound 41421
CHEBI:32508
chebi:32508
glycinate
H2N-CH2-COO(-)
aminoacetate
gly(-)
glycine anion
CHEBI:132194
chebi:132194
glycine-d5
((2)H5)glycine
(2H5)Glycine
pentadeuterioglycine
pentadeuteroglycine
perdeuterioglycine
perdeuteroglycine
CHEBI:15428
chebi:15428
glycine
Aminoacetic acid
Aminoessigsaeure
G
GLYCINE
Gly
Glycin
Glycine
Glycocoll
Glykokoll
Glyzin
H2N-CH2-COOH
Hgly
Leimzucker
aminoacetic acid
aminoethanoic acid
metacyc.compound:GLY
metacycM:GLY
glycine
G
aminoacetic acid
gly
CHEBI:32507
chebi:32507
glycinium
H2gly(+)
NH3(+)-CH2-COOH
carboxymethanaminium
glycine cation
hmdb:HMDB00123
chebi:10792
chebi:14344
chebi:24368
chebi:42964
chebi:5460
biggM:M_gly
keggC:M_C00037
keggD:M_D00011
seedM:M_cpd00033
secondary/obsolete/fantasy identifier