Feedback

2,6-dihydroxypseudooxynicotine

Properties
MNX_IDMNXM2916
formulaC10H15N2O3
charge1
mass211.23778
referencechebi:66944
Image of MNXM2916
InChIKeyJJJLAXLRPLCXNT-UHFFFAOYSA-O
InChIInChI=1S/C10H14N2O3/c1-11-6-2-3-8(13)7-4-5-9(14)12-10(7)15/h4-5,11H,2-3,6H2,1H3,(H2,12,14,15)/p+1
SMILESC[NH2+]CCCC(=O)c1ccc(O)nc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:C15986 2,6-Dihydroxypseudooxynicotine
1-(2,6-Dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one
chebi:28220 2,6-dihydroxypseudooxynicotine
1-(2,6-dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one
seedM:cpd14710 2,6-Dihydroxypseudooxynicotine
1-(2,6-Dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one
2,6-dihydroxy-pseudo-oxynicotine
2,6-dihydroxypseudooxynicotine
chebi:66944 2,6-dihydroxypseudooxynicotine
2,6-dihydroxypseudooxynicotinium(1+)
4-(2,6-dihydroxypyridin-3-yl)-N-methyl-4-oxobutan-1-aminium
metacycM:CPD-113 2,6-dihydroxypseudooxynicotine
2,6-dihydroxy-pseudo-oxynicotine
envipath:...683951723056
sabiorkM:28309
2,6-Dihydroxypseudooxynicotine
chebi:19401
keggC:M_C15986
seedM:M_cpd14710
secondary/obsolete/fantasy identifier