Feedback

2,6-dihydroxypseudooxynicotine

PropertiesImageOccurences in reactions
MNX_IDMNXM2916Image of MNXM2916
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC10H15N2O3
charge1
mass211.23778
referencechebi:66944
InChIKeyJJJLAXLRPLCXNT-UHFFFAOYSA-O
InChIInChI=1S/C10H14N2O3/c1-11-6-2-3-8(13)7-4-5-9(14)12-10(7)15/h4-5,11H,2-3,6H2,1H3,(H2,12,14,15)/p+1
SMILESC[NH2+]CCCC(=O)c1ccc(O)nc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:66944
chebi:66944
2,6-dihydroxypseudooxynicotine
2,6-dihydroxypseudooxynicotinium(1+)
4-(2,6-dihydroxypyridin-3-yl)-N-methyl-4-oxobutan-1-aminium
sabiork.compound:28309
sabiorkM:28309
envipath:...683951723056
envipathM:...683951723056
2,6-Dihydroxypseudooxynicotine
kegg.compound:C15986
keggC:C15986
2,6-Dihydroxypseudooxynicotine
1-(2,6-Dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one
seed.compound:cpd14710
seedM:cpd14710
2,6-Dihydroxypseudooxynicotine
1-(2,6-Dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one
2,6-dihydroxy-pseudo-oxynicotine
2,6-dihydroxypseudooxynicotine
CHEBI:28220
chebi:28220
2,6-dihydroxypseudooxynicotine
1-(2,6-dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one
metacyc.compound:CPD-113
metacycM:CPD-113
2,6-dihydroxypseudooxynicotine
2,6-dihydroxy-pseudo-oxynicotine
chebi:19401
keggC:M_C15986
seedM:M_cpd14710
secondary/obsolete/fantasy identifier