Feedback

2-Oxosuberate

PropertiesImageOccurences in reactions
MNX_IDMNXM2930Image of MNXM2930
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC8H10O5
charge-2
mass186.162
referencechebi:80587
InChIKeyHAGOOZVJLSSXGZ-UHFFFAOYSA-L
InChIInChI=1S/C8H12O5/c9-6(8(12)13)4-2-1-3-5-7(10)11/h1-5H2,(H,10,11)(H,12,13)/p-2
SMILES[O-]C(=O)CCCCCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:80587
chebi:80587
kegg.compound:C16589
keggC:C16589
2-Oxosuberate
2-Oxooctanedionic acid
alpha-Ketosuberate
seed.compound:cpd16398
seedM:cpd16398
2-Oxosuberate
2-Oxooctanedionic acid
2-oxooctanedionic acid
2-oxosuberate
alpha-Ketosuberate
alpha-ketosuberate
metacyc.compound:CPD-337
metacycM:CPD-337
2-oxosuberate
2-oxooctanedionic acid
alpha-ketosuberate
keggC:M_C16589
seedM:M_cpd16398
secondary/obsolete/fantasy identifier