Feedback

3,4-dihydroxyphenylglycol

PropertiesImageOccurences in reactions
MNX_IDMNXM2931Image of MNXM2931
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 3
formulaC8H10O4
charge0
mass170.1626
referencemetacycM:CPD-11878
InChIKeyMTVWFVDWRVYDOR-QMMMGPOBSA-N
InChIInChI=1S/C8H10O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8-12H,4H2/t8-/m0/s1
SMILESOC[C@H](O)c1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
metacyc.compound:CPD-11878
metacycM:CPD-11878
3,4-dihydroxyphenylglycol
3,4-dihydroxyphenylethyleneglycol
4-(1,2-dihydroxyethyl)benzene-1,2-diol
DHPG
DOPEG
dihydroxyphenylethylene glycol
bigg.metabolite:34dhoxpeg
biggM:34dhoxpeg
kegg.compound:C05576
keggC:C05576
3,4-Dihydroxyphenylethyleneglycol
seed.compound:cpd03306
seedM:cpd03306
3,4-Dihydroxyphenylethyleneglycol
3,4-dihydroxyphenylethyleneglycol
3,4-dihydroxyphenylglycol
4-(1,2-dihydroxyethyl)benzene-1,2-diol
DHPG
DOPEG
dihydroxyphenylethylene glycol
hmdb:HMDB0000318 3,4-Dihydroxyphenylglycol
(3,4-Dihydroxyphenyl)ethylene glycol
1-(3,4-Dihydroxyphenyl)-1,2-ethanediol
2-Hydroxy-2-(3,4-dihydroxy)phenylethanol
3,4-Dihydroxyphenethyl glycol
3,4-Dihydroxyphenylethyl glycol
3,4-Dihydroxyphenylethyleneglycol
3,4-dihydroxyphenylglycol
4-(1,2-Dihydroxyethyl)-1,2-benzenediol
4-(1,2-dihydroxyethyl)benzene-1,2-diol
DHPG
DL-3,4-Dihydroxyphenylglycol
DOPEG
Dihydroxyphenylethylene glycol
Dihydroxyphenylethylene glycol, (+-)-isomer
Dihydroxyphenylethylene glycol, (S)-isomer
b,3,4-Trihydroxy phenethyl alcohol
beta,3,4-Trihydroxy phenethyl alcohol
beta,3,4-trihydroxy phenethyl alcohol
CHEBI:1387
chebi:1387
3,4-dihydroxyphenylethyleneglycol
(3,4-dihydroxyphenyl)ethylene glycol
1-(3,4-dihydroxyphenyl)-1,2-ethanediol
2-hydroxy-2-(3,4-dihydroxy)phenylethanol
3,4-Dihydroxyphenylglycol
3,4-dihydroxyphenethyl glycol
3,4-dihydroxyphenylethyl glycol
4-(1,2-dihydroxyethyl)benzene-1,2-diol
DHPG
DOPEG
Dihydroxyphenylethylene glycol
beta,3,4-trihydroxy phenethyl alcohol
envipath:...59cb6d0a68cc
envipathM:...59cb6d0a68cc
compound 42659
hmdb:HMDB0005870
hmdb:HMDB00318
hmdb:HMDB05870
biggM:M_34dhoxpeg
keggC:M_C05576
seedM:M_cpd03306
secondary/obsolete/fantasy identifier