Feedback

3,5-dibromo-4-hydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2932Image of MNXM2932
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC7H2Br2O3
charge-2
mass293.89698
referencechebi:57274
InChIKeyPHWAJJWKNLWZGJ-UHFFFAOYSA-L
InChIInChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12)/p-2
SMILES[O-]C(=O)c1cc(Br)c([O-])c(Br)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57274
chebi:57274
3,5-dibromo-4-hydroxybenzoate
3,5-dibromo-4-oxidobenzoate
3,5-dibromo-4-oxidobenzoate(2-)
envipath:...ada60da89254
envipathM:...ada60da89254
kegg.compound:C03925
keggC:C03925
3,5-Dibromo-4-hydroxybenzoate
seed.compound:cpd02440
seedM:cpd02440
3,5-Dibromo-4-hydroxybenzoate
3,5-dibromo-4-hydroxybenzoate
metacyc.compound:35-DIBROMO-4-HYDROXY-BENZOATE
metacycM:35-DIBROMO-4-HYDROXY-BENZOATE
CHEBI:27544
chebi:27544
3,5-dibromo-4-hydroxybenzoate
CHEBI:1395
chebi:1395
3,5-dibromo-4-hydroxybenzoic acid
3,5-Dibrom-4-hydroxy-benzoesaeure
3,5-dibromo-p-salicylic acid
DiBrHBz
acide dibromo-3,5 hydroxy-4-benzoique
bromoxynylbenzoic acid
chebi:11705
chebi:19897
keggC:M_C03925
seedM:M_cpd02440
secondary/obsolete/fantasy identifier