Feedback

3,5-dibromo-4-hydroxybenzoate

Properties
MNX_IDMNXM2932
formulaC7H2Br2O3
charge-2
mass293.89698
referencechebi:57274
Image of MNXM2932
InChIKeyPHWAJJWKNLWZGJ-UHFFFAOYSA-L
InChIInChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12)/p-2
SMILES[O-]C(=O)c1cc(Br)c([O-])c(Br)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:1395 3,5-dibromo-4-hydroxybenzoic acid
3,5-Dibrom-4-hydroxy-benzoesaeure
3,5-dibromo-p-salicylic acid
DiBrHBz
acide dibromo-3,5 hydroxy-4-benzoique
bromoxynylbenzoic acid
chebi:27544
metacycM:35-DIBROMO-4-HYDROXY-BENZOATE
3,5-dibromo-4-hydroxybenzoate
seedM:cpd02440 3,5-Dibromo-4-hydroxybenzoate
3,5-dibromo-4-hydroxybenzoate
chebi:11705
chebi:19897
keggC:M_C03925
seedM:M_cpd02440
secondary/obsolete/fantasy identifier
chebi:57274 3,5-dibromo-4-hydroxybenzoate
3,5-dibromo-4-oxidobenzoate
3,5-dibromo-4-oxidobenzoate(2-)
envipath:...ada60da89254
keggC:C03925
3,5-Dibromo-4-hydroxybenzoate