Feedback

3,5-dibromo-4-hydroxybenzonitrile

Properties
MNX_IDMNXM2933
formulaC7H2Br2NO
charge-1
mass275.90492
referencechebi:58046
Image of MNXM2933
InChIKeyUPMXNNIRAGDFEH-UHFFFAOYSA-M
InChIInChI=1S/C7H3Br2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H/p-1
SMILES[O-]c1c(Br)cc(cc1Br)C#N

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
metacycM:35-DIBROMO-4-HYDROXYBENZONITRILE 3,5-dibromo-4-hydroxybenzonitrile
chebi:17192 3,5-dibromo-4-hydroxybenzonitrile
2,6-dibromo-4-cyanophenol
3,5-Dibromo-4-hydroxybenzonitrile
bromoxynil
chebi:58046 3,5-dibromo-4-hydroxybenzonitrile
2,6-dibromo-4-cyanobenzen-1-olate
2,6-dibromo-4-cyanophenolate
2,6-dibromo-4-cyanophenolate anion
3,5-dibromo-4-oxidobenzonitrile
3,5-dibromo-4-oxidobenzonitrile anion
3,5-dibromo-4-oxidobenzonitrile(1-)
chebi:11706
chebi:1396
chebi:19898
keggC:M_C04178
seedM:M_cpd02568
secondary/obsolete/fantasy identifier
seedM:cpd02568 Bromoxynil
3,5-Dibromo-4-hydroxybenzonitrile
3,5-dibromo-4-hydroxybenzonitrile
envipath:...4edc99bb290a Bromoxynil
keggC:C04178 Bromoxynil
3,5-Dibromo-4-hydroxybenzonitrile