Feedback

3,5-dibromo-4-hydroxybenzonitrile

PropertiesImageOccurences in reactions
MNX_IDMNXM2933Image of MNXM2933
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 1
formulaC7H2Br2NO
charge-1
mass273.85086
referencechebi:58046
InChIKeyUPMXNNIRAGDFEH-UHFFFAOYSA-M
InChIInChI=1S/C7H3Br2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H/p-1
SMILESN#Cc1cc(Br)c([O-])c(Br)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58046
chebi:58046
3,5-dibromo-4-hydroxybenzonitrile
2,6-dibromo-4-cyanobenzen-1-olate
2,6-dibromo-4-cyanophenolate
2,6-dibromo-4-cyanophenolate anion
3,5-dibromo-4-oxidobenzonitrile
3,5-dibromo-4-oxidobenzonitrile anion
3,5-dibromo-4-oxidobenzonitrile(1-)
metacyc.compound:35-DIBROMO-4-HYDROXYBENZONITRILE
metacycM:35-DIBROMO-4-HYDROXYBENZONITRILE
3,5-dibromo-4-hydroxybenzonitrile
CHEBI:17192
chebi:17192
3,5-dibromo-4-hydroxybenzonitrile
2,6-dibromo-4-cyanophenol
3,5-Dibromo-4-hydroxybenzonitrile
bromoxynil
envipath:...4edc99bb290a
envipathM:...4edc99bb290a
Bromoxynil
kegg.compound:C04178
keggC:C04178
Bromoxynil
3,5-Dibromo-4-hydroxybenzonitrile
seed.compound:cpd02568
seedM:cpd02568
Bromoxynil
3,5-Dibromo-4-hydroxybenzonitrile
3,5-dibromo-4-hydroxybenzonitrile
chebi:11706
chebi:1396
chebi:19898
keggC:M_C04178
seedM:M_cpd02568
secondary/obsolete/fantasy identifier