Feedback

9beta-pimara-7,15-dien-19-oate

Properties
MNX_IDMNXM2960
formulaC20H29O2
charge-1
mass301.44306
referencechebi:63659
Image of MNXM2960
InChIKeyMXYATHGRPJZBNA-BDUQCRIQSA-M
InChIInChI=1S/C20H30O2/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(21)22/h5,7,15-16H,1,6,8-13H2,2-4H3,(H,21,22)/p-1/t15-,16-,18-,19-,20+/m1/s1
SMILESC[C@]1(CC[C@@H]2C(C1)=CC[C@@H]1[C@]2(C)CCC[C@]1(C)C([O-])=O)C=C

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:63659 9beta-pimara-7,15-dien-19-oate
(1S,4aR,4bR,7R,10aR)-7-ethenyl-1,4a,7-trimethyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydrophenanthrene-1-carboxylate
(9beta)-pimara-7,15-dien-19-oate
lipidmaps:LMPR0104080011 9beta-pimara-7,15-dien-19-oic acid
9beta-pimara-7,15-dien-19-oic acid
metacycM:CPD-13923 (-)-9beta-pimara-7,15-dien-19-oate
chebi:63731 9beta-pimara-7,15-dien-19-oic acid
(1S,4aR,4bR,7R,10aR)-7-ethenyl-1,4a,7-trimethyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydrophenanthrene-1-carboxylic acid
(9beta)-pimara-7,15-dien-19-oic acid
syn-pimaradien-19-oic acid
seedM:cpd21382 9beta-Pimara-7,15-dien-19-oate
(-)-9beta-pimara-7,15-dien-19-oate
keggC:M_C20149
seedM:M_cpd21382
secondary/obsolete/fantasy identifier
keggC:C20149 9beta-Pimara-7,15-dien-19-oate