Feedback

eicosanoate

Properties
MNX_IDMNXM2976
formulaC20H39O2
charge-1
mass311.52246
referencechebi:32360
Image of MNXM2976
InChIKeyVKOBVWXKNCXXDE-UHFFFAOYSA-M
InChIInChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/p-1
SMILESCCCCCCCCCCCCCCCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref38
Distinct compatimentalized reactions in models21

Similar chemical compounds in external resources
IdentifierDescription
biggM:arach Arachidic acid
chebi:28822
reactome:R-ALL-879558
reactome:R-ALL-879615
icosanoic acid
Arachidic acid
Arachinsaeure
C20:0
CH3-[CH2]18-COOH
arachic acid
arachidic acid
arachidinic acid
eicosanoic acid
n-eicosanoic acid
keggC:C06425 Icosanoic acid
Arachidic acid
Eicosanoic acid
seedM:cpd03848 Arachidic acid
Eicosanoic acid
Icosanoic acid
arach
arachidate
arachidic acid
eicosanoate
eicosanoic acid
icosanoate
icosanoic acid
icosanoic acid (n-C20:0)
chebi:32360 eicosanoate
(20:0)
CH3-[CH2]18-COO(-)
CH3-[CH2]18-COO(-1)
arachidate
arachidinate
eicosoate
icosanoate
n-eicosanoate
hmdb:HMDB0002212 Arachidic acid
Arachate
Arachic acid
Arachidate
Arachidic acid, ammonium salt
Arachidic acid, barium salt
Arachidic acid, calcium salt
Arachidic acid, magnesium salt
Arachidic acid, potassium salt
Arachidic acid, sodium salt
Arachidinate
Arachidinic acid
Arachinsaeure
C20:0
CH3-[CH2]18-COOH
Eicosanoate
Eicosanoic acid
Eicosoate
Eicosoic acid
Icosanoate
Icosanoic acid
N-Eicosanoate
N-Eicosanoic acid
Zinc arachidate
arachidic acid
icosanoic acid
sabiorkM:2891 Arachidic acid
Eicosanoic acid
Icosanoic acid
metacycM:ARACHIDIC_ACID arachidate
arachidic acid
eicosanoate
eicosanoic acid
icosanoate
icosanoic acid
icosanoic acid (n-C20:0)
slm:000000829 eicosanoate
Arachidate
Icosanoate
biggM:M_arach
chebi:24763
chebi:2798
hmdb:HMDB02212
keggC:M_C06425
seedM:M_cpd03848
secondary/obsolete/fantasy identifier
lipidmaps:LMFA01010020 Arachidic acid
Arachic acid
Arachidate
C20:0
Eicosanoate
Eicosanoic acid
FA(20:0)
Icosanoic acid
n-Eicosanoic acid
MNXM102790is deprecated and replaced by this entry