Feedback

eicosanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2976Image of MNXM2976
#reac
in my sandbox 0
in MNXref (generic)39
in models (compartimentalized) 47
formulaC20H39O2
charge-1
mass311.29555
referencechebi:32360
InChIKeyVKOBVWXKNCXXDE-UHFFFAOYSA-M
InChIInChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/p-1
SMILESCCCCCCCCCCCCCCCCCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:32360
chebi:32360
eicosanoate
(20:0)
CH3-[CH2]18-COO(-)
CH3-[CH2]18-COO(-1)
arachidate
arachidinate
eicosoate
icosanoate
n-eicosanoate
bigg.metabolite:arach
biggM:arach
Arachidic acid
lipidmaps:LMFA01010049
lipidmapsM:LMFA01010049
Arachidic acid(d3)
Eicosanoic acid(d3)
hmdb:HMDB0002212 Arachidic acid
Arachate
Arachic acid
Arachidate
Arachidinate
Arachidinic acid
Arachinsaeure
C 20
C20 fatty acid
C20:0
CH3-[CH2]18-COOH
Eicosanoate
Eicosanoic acid
Eicosoate
Eicosoic acid
FA(20:0)
Icosanoate
Icosanoic acid
N-Eicosanoate
N-Eicosanoic acid
Peanut acid
arachidic acid
icosanoic acid
n-Eicosanic acid
lipidmaps:LMFA01010020
lipidmapsM:LMFA01010020
Arachidic acid
Arachic acid
Arachidate
C20:0
Eicosanoate
Eicosanoic acid
FA 20:0
Icosanoic acid
n-Eicosanoic acid
sabiork.compound:2891
sabiorkM:2891
Arachidic acid
Eicosanoic acid
Icosanoic acid
seed.compound:cpd03848
seedM:cpd03848
Arachidic acid
Eicosanoic acid
Icosanoic acid
arach
arachidate
arachidic acid
eicosanoate
eicosanoic acid
icosanoate
icosanoic acid
icosanoic acid (n-C20:0)
kegg.compound:C06425
keggC:C06425
Icosanoic acid
Arachidic acid
Eicosanoic acid
metacyc.compound:ARACHIDIC_ACID
metacycM:ARACHIDIC_ACID
arachidate
arachidic acid
eicosanoate
eicosanoic acid
icosanoate
icosanoic acid
icosanoic acid (n-C20:0)
SLM:000000829
slm:000000829
eicosanoate
Arachidate
Icosanoate
reactome:R-ALL-879558
reactomeM:R-ALL-879558
reactome:R-ALL-879615
reactomeM:R-ALL-879615
CHEBI:28822
chebi:28822
icosanoic acid
Arachidic acid
Arachinsaeure
C20:0
CH3-[CH2]18-COOH
arachic acid
arachidic acid
arachidinic acid
eicosanoic acid
n-eicosanoic acid
hmdb:HMDB02212
chebi:24763
chebi:2798
biggM:M_arach
keggC:M_C06425
seedM:M_cpd03848
secondary/obsolete/fantasy identifier