Feedback

eicosanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2976Image of MNXM2976
#reac
in my sandbox 0
in MNXref (generic)41
in models (compartimentalized) 22
formulaC20H39O2
charge-1
mass311.52246
referencechebi:32360
InChIKeyVKOBVWXKNCXXDE-UHFFFAOYSA-M
InChIInChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/p-1
SMILESCCCCCCCCCCCCCCCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:32360
chebi:32360
eicosanoate
(20:0)
CH3-[CH2]18-COO(-)
CH3-[CH2]18-COO(-1)
arachidate
arachidinate
eicosoate
icosanoate
n-eicosanoate
bigg.metabolite:arach
biggM:arach
Arachidic acid
hmdb:HMDB0002212 Arachidic acid
Arachate
Arachic acid
Arachidate
Arachidic acid, ammonium salt
Arachidic acid, barium salt
Arachidic acid, calcium salt
Arachidic acid, magnesium salt
Arachidic acid, potassium salt
Arachidic acid, sodium salt
Arachidinate
Arachidinic acid
Arachinsaeure
C20:0
CH3-[CH2]18-COOH
Eicosanoate
Eicosanoic acid
Eicosoate
Eicosoic acid
Icosanoate
Icosanoic acid
N-Eicosanoate
N-Eicosanoic acid
Zinc arachidate
arachidic acid
icosanoic acid
lipidmaps:LMFA01010020
lipidmapsM:LMFA01010020
Arachidic acid
Arachic acid
Arachidate
C20:0
Eicosanoate
Eicosanoic acid
FA(20:0)
Icosanoic acid
n-Eicosanoic acid
sabiork.compound:2891
sabiorkM:2891
Arachidic acid
Eicosanoic acid
Icosanoic acid
seed.compound:cpd03848
seedM:cpd03848
Arachidic acid
Eicosanoic acid
Icosanoic acid
arach
arachidate
arachidic acid
eicosanoate
eicosanoic acid
icosanoate
icosanoic acid
icosanoic acid (n-C20:0)
kegg.compound:C06425
keggC:C06425
Icosanoic acid
Arachidic acid
Eicosanoic acid
metacyc.compound:ARACHIDIC_ACID
metacycM:ARACHIDIC_ACID
arachidate
arachidic acid
eicosanoate
eicosanoic acid
icosanoate
icosanoic acid
icosanoic acid (n-C20:0)
SLM:000000829
slm:000000829
eicosanoate
Arachidate
Icosanoate
reactome:R-ALL-879558
reactomeM:R-ALL-879558
reactome:R-ALL-879615
reactomeM:R-ALL-879615
CHEBI:28822
chebi:28822
icosanoic acid
Arachidic acid
Arachinsaeure
C20:0
CH3-[CH2]18-COOH
arachic acid
arachidic acid
arachidinic acid
eicosanoic acid
n-eicosanoic acid
hmdb:HMDB02212
chebi:24763
chebi:2798
biggM:M_arach
keggC:M_C06425
seedM:M_cpd03848
secondary/obsolete/fantasy identifier