Feedback

ATP

PropertiesImageOccurences in reactions
MNX_IDMNXM3Image of MNXM3
#reac
in my sandbox 0
in MNXref (generic)6023
in models (compartimentalized) 4210
formulaC10H12N5O13P3
charge-4
mass502.96664
referencechebi:30616
InChIKeyZKHQWZAMYRWXGA-KQYNXXCUSA-J
InChIInChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/p-4/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113592
reactomeM:R-ALL-113592
reactome:R-ALL-113593
reactomeM:R-ALL-113593
reactome:R-ALL-114570
reactomeM:R-ALL-114570
reactome:R-ALL-114571
reactomeM:R-ALL-114571
reactome:R-ALL-139836
reactomeM:R-ALL-139836
reactome:R-ALL-211579
reactomeM:R-ALL-211579
reactome:R-ALL-29358
reactomeM:R-ALL-29358
reactome:R-ALL-389573
reactomeM:R-ALL-389573
reactome:R-ALL-5632460
reactomeM:R-ALL-5632460
CHEBI:30616
chebi:30616
ATP
ATP(4-)
adenosine 5'-triphosphate(4-)
atp
CHEBI:237958
chebi:237958
({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(9H-purin-9-yl)oxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate
bigg.metabolite:atp
biggM:atp
ATP
CHEBI:57299
chebi:57299
ATP(3-)
CHEBI:15422
chebi:15422
ATP
ADENOSINE-5'-TRIPHOSPHATE
Adenosine 5'-triphosphate
Adenosine triphosphate
H4atp
adenosine 5'-(tetrahydrogen triphosphate)
kegg.compound:C00002
keggC:C00002
ATP
Adenosine 5'-triphosphate
sabiork.compound:34
sabiorkM:34
ATP
Adenosine 5'-triphosphate
Adenosine triphosphate
seed.compound:cpd00002
seedM:cpd00002
ATP
Adenosine 5'-triphosphate
adenosine-5'-triphosphate
adenosine-triphosphate
adenylpyrophosphate
atp
metacyc.compound:ATP
metacycM:ATP
ATP
adenosine-5'-triphosphate
adenosine-triphosphate
adenylpyrophosphate
hmdb:HMDB0000538 Adenosine triphosphate
({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid
5'-(Tetrahydrogen triphosphate) adenosine
5'-ATP
ADENOSINE-5'-triphosphATE
ADENOSINE-5'-triphosphoric acid
ATP
ATP MGCL2
ATP-MGCL2
Adenosine 5'-triphosphate
Adenosine 5'-triphosphorate
Adenosine 5'-triphosphoric acid
Adenosine triphosphate, calcium salt
Adenosine triphosphate, chromium ammonium salt
Adenosine triphosphate, chromium salt
Adenosine triphosphate, magnesium chloride
Adenosine triphosphate, magnesium salt
Adenosine triphosphate, manganese salt
Adenosine triphosphoric acid
Adenylpyrophosphate
Adenylpyrophosphorate
Adenylpyrophosphoric acid
Adephos
Adetol
Adynol
Atipi
Atriphos
CR(H2O)4 ATP
CaATP
Cardenosine
Chromium adenosine triphosphate
CrATP
Fosfobion
Glucobasin
H4ATP
Magnesium adenosine triphosphate
Manganese adenosine triphosphate
MgATP
MnATP
Myotriphos
Phosphobion
Striadyne
Triadenyl
Triphosphaden
Triphosphoric acid adenosine ester
adenosine triphosphate
kegg.drug:D08646
keggD:D08646
Triphosadenine (DCF)
ATP
hmdb:HMDB00538
chebi:10789
chebi:10841
chebi:13236
chebi:22249
chebi:2359
chebi:40938
biggM:M_atp
keggC:M_C00002
keggD:M_D08646
seedM:M_cpd00002
secondary/obsolete/fantasy identifier