Feedback

sarcosine

PropertiesImageOccurences in reactions
MNX_IDMNXM300Image of MNXM300
#reac
in my sandbox 0
in MNXref (generic)43
in models (compartimentalized) 17
formulaC3H7NO2
charge0
mass89.09322
referencechebi:57433
InChIKeyFSYKKLYZXJSNPZ-UHFFFAOYSA-N
InChIInChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)
SMILESC[NH2+]CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57433
chebi:57433
sarcosine
(methylammonio)acetate
(methylazaniumyl)acetate
2-(methylazaniumyl)acetate
sarcosine zwitterion
bigg.metabolite:sarcs
biggM:sarcs
envipath:...abb5483b5499
envipathM:...abb5483b5499
Sarcosine
hmdb:HMDB0000271 Sarcosine
(methylamino)-Acetate
(methylamino)-Acetic acid
(methylamino)Acetate
(methylamino)Acetic acid
(methylamino)Ethanoate
(methylamino)Ethanoic acid
2-(methylamino)acetic acid
L-Sarcosine
Magnesium sarcosylate
MeGly
Methylaminoacetate
Methylaminoacetic acid
Methylglycine
N Methylglycine
N-Methyl-glycine
N-Methylaminoacetate
N-Methylaminoacetic acid
N-Methylglycine
Sar
Sarcosin
Sarcosinate
Sarcosinate, sodium
Sarcosine hydrochloride
Sarcosine monosodium salt
Sarcosinic acid
Sarcosylate, magnesium
Sodium sarcosinate
sarcosine
sabiork.compound:1976
sabiorkM:1976
kegg.compound:C00213
keggC:C00213
Sarcosine
N-Methylglycine
seed.compound:cpd00183
seedM:cpd00183
Sarcosine
N-Methylglycine
N-methylglycine
sarcosine
sarcs
envipath:...d6ffddb140b3
envipathM:...d6ffddb140b3
compound 41902
CHEBI:46915
chebi:46915
sarcosinate
(methylamino)acetate
CHEBI:15611
chebi:15611
sarcosine
(methylamino)acetic acid
(methylamino)ethanoic acid
L-sarcosine
MeGly
N-Methylglycine
N-methylaminoacetic acid
SARCOSINE
Sar
Sarcosine
methylaminoacetic acid
sarcosinic acid
metacyc.compound:SARCOSINE
metacycM:SARCOSINE
sarcosine
N-methylglycine
CHEBI:46842
chebi:46842
sarcosinium
carboxy-N-methylmethanaminium
hmdb:HMDB00271
chebi:10876
chebi:12609
chebi:15065
chebi:21765
chebi:45381
chebi:45442
chebi:45531
chebi:45614
chebi:9029
biggM:M_sarcs
keggC:M_C00213
seedM:M_cpd00183
secondary/obsolete/fantasy identifier