Feedback

valproic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM3115Image of MNXM3115
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC8H15O2
charge-1
mass143.2035
referencechebi:39867
InChIKeyNIJJYAXOARWZEE-UHFFFAOYSA-M
InChIInChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1
SMILESCCCC(CCC)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:39867
chebi:39867
valproic acid
2-PROPYL-PENTANOIC ACID
2-n-propyl-n-valeric acid
2-propylpentanoic acid
2-propylvaleric acid
4-heptanecarboxylic acid
DPA
Depakene
Di-n-propylessigsaeure
VALPROIC ACID
VPA
Valproinsaeure
acide valproique
acido valproico
acidum valproicum
di-n-propylacetic acid
dipropylacetic acid
n-DPA
kegg.compound:C07185
keggC:C07185
Valproic acid
kegg.drug:D00399
keggD:D00399
Valproic acid (USP)
Depakene (TN)
hmdb:HMDB0001877 Valproic acid
(N-C3H7)2chcooh
(S)-2-Propyl-4-pentanoate
(S)-2-Propyl-4-pentanoic acid
2 Propylpentanoic acid
2-N-Propyl-N-valerate
2-N-Propyl-N-valeric acid
2-PROPYL-pentanoIC ACID
2-PROPYL-pentanoate
2-Propylpentanoate
2-Propylpentanoic acid
2-Propylvalerate
2-Propylvaleric acid
2-propylpentanoic acid
4-Heptanecarboxylate
4-Heptanecarboxylic acid
Acetate, dipropyl
Acid, propylisopropylacetic
Acid, valproic
Acide valproique
Acidum valproicum
Alti-valproic
Avugane
Baceca
Calcium valproate
Calcium, valproate
Convulex
Convulsofin
DOM-divalproex
DOM-valproic
DOM-valproic acid e.c.
DPA
Delepsine
Depakene
Depakin
Depakin chrono
Depakine
Depakine chrono
Depakote
Deproic
Di-N-propylacetate
Di-N-propylacetic acid
Di-N-propylessigsaeure
Di-N-propylessigsaure
Dipropyl acetate
Dipropylacetate
Dipropylacetic acid
Divalproex
Divalproex sodium
Dom-valproate
Dom-valproic acid
Dom-valproic acid syrup
Epiject i.v.
Epilex
Epilim
Epival
Epival er
Ergenyl
Gen-divalproex
Kyselina 2-propylvalerova
Magnesium valproate
Med valproic
Mylproin
Myproate
Myproic acid
N-DPA
N-Dipropylacetic acid
Nu-valproic
PEAC
PHL-Valproate
PHL-Valproic acid
PHL-Valproic acid e.c.
PMS-Divalproex
PMS-Valproate
PMS-Valproic acid
PMS-Valproic acid e.c.
Penta-valproic
Propylisopropylacetic acid
Propylvaleric acid
S(-)-4-En-valproate
S(-)-4-En-valproic acid
S-2-N-Propyl-4-pentenoate
S-2-N-Propyl-4-pentenoic acid
Sandoz valproic
Savicol
Semisodium valproate
Sodium valproate
Sodium, divalproex
Sodium, valproate
Sprinkle
VPA
Valcote
Valparin
Valproate
Valproate calcium
Valproate sodium
Valproate, calcium
Valproate, magnesium
Valproate, semisodium
Valproate, sodium
Valproic acid usp
Valproic acid, sodium salt (2:1)
Valproinsaeure
Vupral
acido Valproico
apo-Divalproex
apo-Valproic
apo-Valproic syrup
novo-Divalproex
novo-Valproic
novo-Valproic - ecc
novo-Valproic soft gel cap
ratio-Valproic - ecc
valproic acid
seed.compound:cpd16327
seedM:cpd16327
Valproic acid
2-propylpentanoate
2-propylpentanoic acid
valproate
valproic acid
lipidmaps:LMFA01020291
lipidmapsM:LMFA01020291
Valproic acid
2-propylpentanoic acid
FA(8:0)
metacyc.compound:CPD-19635
metacycM:CPD-19635
valproate
2-propylpentanoate
2-propylpentanoic acid
valproic acid
CHEBI:60654
chebi:60654
valproate
2-propylpentanoate
2-propylvalerate
dipropylacetate
hmdb:HMDB01877
chebi:115217
chebi:39858
chebi:68615
chebi:9926
keggC:M_C07185
keggD:M_D00399
seedM:M_cpd16327
secondary/obsolete/fantasy identifier