Feedback

 

2-oxopent-4-enoate

Image of MNXM312
Properties
MNX_IDMNXM312
formulaC5H5O3
charge-1
mass113.0919
referencechebi:11641
InChIKeyNOXRYJAWRSNUJD-UHFFFAOYSA-M
InChIInChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2H,1,3H2,(H,7,8)/p-1
SMILES[O-]C(=O)C(=O)CC=C

This chemical compound does not exist in my selection



Occurrences of 2-oxopent-4-enoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:11641 2-Oxopent-4-enoate
2-oxopent-4-enoate
NOXRYJAWRSNUJD-UHFFFAOYSA-M
Oxopent-4-enoate
chebi:18355
chebi:19594
2-hydroxy-2,4-pentadienoic acid
2-hydroxypenta-2,4-dienoic acid
HPD
VHTQQDXPNUTMNB-UHFFFAOYSA-N
chebi:37318 2-keto-4-pentenoic acid
2-oxo-4-pentenoic acid
2-oxopent-4-enoic acid
NOXRYJAWRSNUJD-UHFFFAOYSA-N
chebi:37319 2-Hydroxy-2,4-pentadienoate
2-Hydroxypenta-2,4-dienoate
2-hydroxypenta-2,4-dienoate
VHTQQDXPNUTMNB-UHFFFAOYSA-M
bigg:op4en
envipath:...04c0ab74e738
2-Oxopent-4-enoate
metacyc:OXOPENTENOATE 2-keto-4-pentenoate
2-keto-4-pentenoic acid
2-ketopent-4-enoic acid
2-oxo-4-pentenoate
2-oxopent-4-enoate
2-oxopentenoate
OXOPENTENOATE
oxopent-4-enoate
sabiork:28913 2-Keto-4-pentenoate
2-Keto-4-pentenoic acid
2-Oxo-4-pentenoate
2-Oxopent-4-enoate
2-Oxopent-4-enoic acid
Oxopent-4-enoate
seed:cpd27712 2-keto-4-pentenoate
2-keto-4-pentenoic acid
2-ketopent-4-enoic acid
2-oxo-4-pentenoate
2-oxopent-4-enoate
2-oxopentenoate
oxopent-4-enoate