Feedback

(3R)-3-isopropenyl-6-oxoheptanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3124Image of MNXM3124
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC10H15O3
charge-1
mass183.2243
referencechebi:29001
InChIKeyNJOIWWRMLFSDTM-SECBINFHSA-M
InChIInChI=1S/C10H16O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h9H,1,4-6H2,2-3H3,(H,12,13)/p-1/t9-/m1/s1
SMILESCC(=C)[C@H](CCC(C)=O)CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29001
chebi:29001
(3R)-3-isopropenyl-6-oxoheptanoate
(3R)-3-Isopropenyl-6-oxoheptanoate
(3R)-4-methyl-3-(3-oxobutyl)pent-4-enoate
(3R)-6-oxo-3-(prop-1-en-2-yl)heptanoate
envipath:...11efdd4590cd
envipathM:...11efdd4590cd
(3R)-3-Isopropenyl-6-oxoheptanoate
kegg.compound:C11405
keggC:C11405
(3R)-3-Isopropenyl-6-oxoheptanoate
(3R)-3-Isopropenyl-6-oxoheptanoic acid
seed.compound:cpd08259
seedM:cpd08259
(3R)-3-Isopropenyl-6-oxoheptanoate
(3R)-3-Isopropenyl-6-oxoheptanoic acid
(3R)-3-isopropenyl-6-oxoheptanoate
metacyc.compound:CPD-10053
metacycM:CPD-10053
(3R)-3-isopropenyl-6-oxoheptanoate
CHEBI:37287
chebi:37287
(3R)-3-isopropenyl-6-oxoheptanoic acid
(3R)-3-Isopropenyl-6-oxoheptanoic acid
(3R)-4-methyl-3-(3-oxobutyl)pent-4-enoic acid
(3R)-6-oxo-3-(prop-1-en-2-yl)heptanoic acid
lipidmaps:LMFA01060179
lipidmapsM:LMFA01060179
(3R)-3-isopropenyl-6-oxoheptanoic acid
(3R)-4-methyl-3-(3-oxobutyl)pent-4-enoic acid
6-oxo-3R-(prop-1-en-2-yl)heptanoic acid
FA(10:1(Ke))
chebi:18560
chebi:202
keggC:M_C11405
seedM:M_cpd08259
secondary/obsolete/fantasy identifier