Feedback

(R)-piperazine-2-carboxylate

Properties
MNX_IDMNXM3130
formulaC5H10N2O2
charge0
mass130.14518
referencechebi:58917
Image of MNXM3130
InChIKeyJSSXHAMIXJGYCS-SCSAIBSYSA-N
InChIInChI=1S/C5H10N2O2/c8-5(9)4-3-6-1-2-7-4/h4,6-7H,1-3H2,(H,8,9)/t4-/m1/s1
SMILES[O-]C(=O)[C@H]1CNCC[NH2+]1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:55358 (R)-piperazine-2-carboxylate
(2R)-piperazine-2-carboxylate
metacycM:CPD-11622 (R)-piperazine-2-carboxylate
(R)-piperazine-2-carboxylic acid
chebi:58917 (R)-piperazine-2-carboxylate
(2R)-piperazin-1-ium-2-carboxylate
(R)-piperazine-2-carboxylic acid zwitterion
chebi:55357 (R)-piperazine-2-carboxylic acid
(2R)-piperazine-2-carboxylic acid
keggC:C19780 (R)-Piperazine-2-carboxylate
(R)-2-Piperazinecarboxylate
(R)-Piperazine-2-carboxylic acid
keggC:M_C19780
seedM:M_cpd21025
secondary/obsolete/fantasy identifier
seedM:cpd21025 (R)-Piperazine-2-carboxylic acid
(R)-2-Piperazinecarboxylate
(R)-piperazine-2-carboxylate
(R)-piperazine-2-carboxylic acid