Feedback

(R)-piperazine-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM3130Image of MNXM3130
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC5H10N2O2
charge0
mass130.14518
referencechebi:58917
InChIKeyJSSXHAMIXJGYCS-SCSAIBSYSA-N
InChIInChI=1S/C5H10N2O2/c8-5(9)4-3-6-1-2-7-4/h4,6-7H,1-3H2,(H,8,9)/t4-/m1/s1
SMILES[O-]C(=O)[C@H]1CNCC[NH2+]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58917
chebi:58917
(R)-piperazine-2-carboxylate
(2R)-piperazin-1-ium-2-carboxylate
(R)-piperazine-2-carboxylic acid zwitterion
kegg.compound:C19780
keggC:C19780
(R)-Piperazine-2-carboxylate
(R)-2-Piperazinecarboxylate
(R)-Piperazine-2-carboxylic acid
seed.compound:cpd21025
seedM:cpd21025
(R)-Piperazine-2-carboxylic acid
(R)-2-Piperazinecarboxylate
(R)-piperazine-2-carboxylate
(R)-piperazine-2-carboxylic acid
CHEBI:55358
chebi:55358
(R)-piperazine-2-carboxylate
(2R)-piperazine-2-carboxylate
metacyc.compound:CPD-11622
metacycM:CPD-11622
(R)-piperazine-2-carboxylate
(R)-piperazine-2-carboxylic acid
CHEBI:55357
chebi:55357
(R)-piperazine-2-carboxylic acid
(2R)-piperazine-2-carboxylic acid
keggC:M_C19780
seedM:M_cpd21025
secondary/obsolete/fantasy identifier