Feedback

tetradecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM314Image of MNXM314
#reac
in my sandbox 0
in MNXref (generic)167
in models (compartimentalized) 73
formulaC14H27O2
charge-1
mass227.36298
referencechebi:30807
InChIKeyTUNFSRHWOTWDNC-UHFFFAOYSA-M
InChIInChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/p-1
SMILESCCCCCCCCCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30807
chebi:30807
tetradecanoate
1-tetradecanecarboxylate
CH3-[CH2]12-COO(-)
Tetradecanoate
myristate
n-tetradecan-1-oate
n-tetradecoate
tetradecoate
hmdb:HMDB0000806 Myristic acid
1-Tetradecanecarboxylate
1-Tetradecanecarboxylic acid
1-Tridecanecarboxylate
1-Tridecanecarboxylic acid
14
14:0
14:00
Acid, myristic
Acid, tetradecanoic
Acide tetradecanoique
C14
CH3-[CH2]12-COOH
Crodacid
Myristate
Myristic acid pure
Myristinsaeure
Myristoate
Myristoic acid
N-Tetradecan-1-Oate
N-Tetradecan-1-Oic acid
N-Tetradecanoate
N-Tetradecanoic acid
N-Tetradecoate
N-Tetradecoic acid
Tetradecanoate
Tetradecanoic (myristic) acid
Tetradecanoic acid
Tetradecoate
Tetradecoic acid
myristic acid
tetradecanoic acid
lipidmaps:LMFA01010014
lipidmapsM:LMFA01010014
Myristic acid
C14:0
FA(14:0)
tetradecanoic acid
sabiork.compound:2890
sabiorkM:2890
Myristic acid
Tetradecanoate
Tetradecanoic acid
seed.compound:cpd03847
seedM:cpd03847
Myristic acid
Tetradecanoate
Tetradecanoic acid
myristate
myristic acid
tetradecanoate
tetradecanoate (C14:0)
tetradecanoate (n-C14:0)
tetradecanoic acid
tetradecoate
tetradecoic acid
ttdca
bigg.metabolite:ttdca
biggM:ttdca
Tetradecanoate (n-C14:0)
kegg.compound:C06424
keggC:C06424
Tetradecanoic acid
Myristic acid
Tetradecanoate
metacyc.compound:CPD-7836
metacycM:CPD-7836
myristate
myristic acid
tetradecanoate
tetradecanoic acid
tetradecoate
tetradecoic acid
SLM:000000825
slm:000000825
tetradecanoate
Myristate
reactome:R-ALL-400514
reactomeM:R-ALL-400514
reactome:R-ALL-879604
reactomeM:R-ALL-879604
CHEBI:28875
chebi:28875
tetradecanoic acid
1-tetradecanecarboxylic acid
14
14:0
14:00
C14
CH3-[CH2]12-COOH
MYRISTIC ACID
Myristic acid
Myristinsaeure
Tetradecanoic acid
acide tetradecanoique
myristic acid
n-Tetradecan-1-oic acid
n-Tetradecoic acid
n-tetradecanoic acid
tetradecoic acid
CHEBI:134623
chebi:134623
tetradecanoic-d27 acid
((2)H27)tetradecanoic acid
myristic acid-d27
myristic-d27 acid
perdeuteromyristic acid
perdeuterotetradecanoic acid
tetradecanoic acid-d27
hmdb:HMDB00806
chebi:26897
chebi:278516
chebi:35292
chebi:44232
chebi:7056
chebi:73168
biggM:M_ttdca
keggC:M_C06424
seedM:M_cpd03847
secondary/obsolete/fantasy identifier