Feedback

2,6-dihydroxynicotinate

PropertiesImageOccurences in reactions
MNX_IDMNXM3155Image of MNXM3155
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC6H4NO4
charge-1
mass154.01458
referencechebi:58780
InChIKeyIGCZQNUHGOYVJI-UHFFFAOYSA-M
InChIInChI=1S/C6H5NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)/p-1
SMILESO=C([O-])c1ccc(O)nc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58780
chebi:58780
2,6-dihydroxynicotinate
2,6-dihydroxypyridine-3-carboxylate
kegg.compound:C15523
keggC:C15523
2,6-Dihydroxynicotinate
seed.compound:cpd11202
seedM:cpd11202
2,6-Dihydroxynicotinate
2,6-dihydroxynicotinate
metacyc.compound:CPD-6962
metacycM:CPD-6962
2,6-dihydroxynicotinate
CHEBI:49087
chebi:49087
2,6-dihydroxynicotinic acid
2,6-Dihydroxynicotinate
2,6-dihydroxypyridine-3-carboxylic acid
keggC:M_C15523
seedM:M_cpd11202
secondary/obsolete/fantasy identifier