Feedback

2-oxohexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3161Image of MNXM3161
#reac
in my sandbox 0
in MNXref (generic)13
in models (compartimentalized) 1
formulaC6H9O3
charge-1
mass129.05572
referencechebi:35177
InChIKeyXNIHZNNZJHYHLC-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1
SMILESCCCCC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:35177
chebi:35177
2-oxohexanoate
2-Oxohexanoate
2-ketocaproate
2-ketohexanoate
2-oxocaproate
hmdb:HMDB0001864 2-Ketohexanoic acid
2-Keto-N-caproate
2-Keto-N-caproic acid
2-Ketocaproate
2-Ketocaproic acid
2-Ketohexanoate
2-Oxohexanoate
2-Oxohexanoic acid
2-oxo 6:0
2-oxo C6:0
2-oxo-Hexanoate
2-oxo-Hexanoic acid
2-oxohexanoic acid
a-Ketocaproate
a-Ketocaproic acid
a-Ketohexanoate
a-Ketohexanoic acid
alpha-Ketocaproate
alpha-Ketocaproic acid
alpha-Ketocaproic acid, sodium salt
alpha-Ketohexanoate
alpha-Ketohexanoic acid
alpha-ketocaproate
alpha-ketocaproic acid
alpha-ketohexanoate
alpha-ketohexanoic acid
sabiork.compound:2183
sabiorkM:2183
2-Oxohexanoate
2-Oxocaproate
alpha-Oxocaproic acid
seed.compound:cpd00669
seedM:cpd00669
2-Oxohexanoate
2-Oxohexanoic acid
2-ketocaproate
2-oxohexanoate
alpha-Ketocaproic acid
alpha-ketocaproate
kegg.compound:C00902
keggC:C00902
2-Oxohexanoic acid
2-Oxohexanoate
alpha-Ketocaproic acid
lipidmaps:LMFA01060007
lipidmapsM:LMFA01060007
2-keto-n-caproic acid
2-oxo-hexanoic acid
FA 6:1
O
metacyc.compound:2-OXOHEXANOATE
metacycM:2-OXOHEXANOATE
2-oxohexanoate
2-ketocaproate
alpha-ketocaproate
CHEBI:17308
chebi:17308
2-oxohexanoic acid
2-Oxohexanoate
2-Oxohexanoic acid
2-keto-n-caproic acid
2-ketohexanoic acid
2-oxo 6:0
2-oxo C6:0
alpha-Ketocaproic acid
alpha-ketocaproic acid
alpha-ketohexanoic acid
hmdb:HMDB01864
chebi:11640
chebi:1256
chebi:19752
keggC:M_C00902
seedM:M_cpd00669
secondary/obsolete/fantasy identifier