Feedback

2-oxohexanoate

Properties
MNX_IDMNXM3161
formulaC6H9O3
charge-1
mass129.13386
referencechebi:35177
Image of MNXM3161
InChIKeyXNIHZNNZJHYHLC-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1
SMILESCCCCC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:2183 2-Oxohexanoate
2-Oxocaproate
alpha-Oxocaproic acid
chebi:35177 2-oxohexanoate
2-Oxohexanoate
2-ketocaproate
2-ketohexanoate
2-oxocaproate
metacycM:2-OXOHEXANOATE 2-oxohexanoate
2-ketocaproate
alpha-ketocaproate
keggC:C00902 2-Oxohexanoic acid
2-Oxohexanoate
alpha-Ketocaproic acid
chebi:11640
chebi:1256
chebi:19752
hmdb:HMDB01864
keggC:M_C00902
seedM:M_cpd00669
secondary/obsolete/fantasy identifier
chebi:17308 2-oxohexanoic acid
2-Oxohexanoate
2-Oxohexanoic acid
2-keto-n-caproic acid
2-ketohexanoic acid
2-oxo 6:0
2-oxo C6:0
alpha-Ketocaproic acid
alpha-ketocaproic acid
alpha-ketohexanoic acid
seedM:cpd00669 2-Oxohexanoate
2-Oxohexanoic acid
2-ketocaproate
2-oxohexanoate
alpha-Ketocaproic acid
alpha-ketocaproate
lipidmaps:LMFA01060007 2-keto-n-caproic acid
2-oxo-hexanoic acid
FA(6:0(Ke))
hmdb:HMDB0001864 2-Ketohexanoic acid
2-Ketocaproate
2-Ketocaproic acid
2-Ketohexanoate
2-Oxohexanoate
2-Oxohexanoic acid
2-keto-N-Caproate
2-keto-N-Caproic acid
2-oxo 6:0
2-oxo C6:0
2-oxo-Hexanoate
2-oxo-Hexanoic acid
2-oxohexanoic acid
a-Ketocaproate
a-Ketocaproic acid
a-Ketohexanoate
a-Ketohexanoic acid
alpha-Ketocaproate
alpha-Ketocaproic acid
alpha-Ketocaproic acid, sodium salt
alpha-Ketohexanoate
alpha-Ketohexanoic acid
alpha-ketocaproate
alpha-ketocaproic acid
alpha-ketohexanoate
alpha-ketohexanoic acid
MNXM480331is deprecated and replaced by this entry