Feedback

3-oxo-3-phenylpropanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3171Image of MNXM3171
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 1
formulaC9H7O3
charge-1
mass163.15008
referencechebi:22731
InChIKeyHXUIDZOMTRMIOE-UHFFFAOYSA-M
InChIInChI=1S/C9H8O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)/p-1
SMILES[O-]C(=O)CC(=O)c1ccccc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:22731
chebi:22731
3-oxo-3-phenylpropanoate
3-oxo-3-phenylpropionate
kegg.compound:C07114
keggC:C07114
3-Oxo-3-phenylpropanoate
3-Oxo-3-phenylpropionate
3-Oxo-3-phenylpropionic acid
Benzoylacetate
metacyc.compound:BENZOYL-ACETATE
metacycM:BENZOYL-ACETATE
3-oxo-3-phenylpropanoate
benzoyl-acetate
CHEBI:28759
chebi:28759
3-oxo-3-phenylpropionic acid
3-keto-3-phenylpropionic acid
3-oxo-3-phenylpropanoic acid
benzoylacetic acid
envipath:...433ddc0ce121
envipathM:...433ddc0ce121
Benzoyl acetate
seed.compound:cpd04386
seedM:cpd04386
Benzoyl acetate
3-Oxo-3-phenylpropanoate
3-Oxo-3-phenylpropionate
3-Oxo-3-phenylpropionic acid
3-oxo-3-phenylpropanoate
Benzoylacetate
benzoyl-acetate
envipath:...28b10248a4c0
envipathM:...28b10248a4c0
compound 39018
chebi:3036
keggC:M_C07114
seedM:M_cpd04386
secondary/obsolete/fantasy identifier