Feedback

3-oxododecanoate

Properties
MNX_IDMNXM3172
formulaC12H21O3
charge-1
mass213.29334
referencechebi:29743
Image of MNXM3172
InChIKeyDZHSPYMHDVROSM-UHFFFAOYSA-M
InChIInChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h2-10H2,1H3,(H,14,15)/p-1
SMILESCCCCCCCCCC(=O)CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
lipidmaps:LMFA01060091 3-oxo-dodecanoic acid
3-oxo-dodecanoic acid
FA(12:0(Ke))
chebi:29743 3-oxododecanoate
3-Oxododecanoate
chebi:18037 3-oxolauric acid
3-Oxododecanoate
3-Oxododecanoic acid
3-oxododecanoic acid
keggC:C02367 3-Oxododecanoic acid
3-Oxododecanoate
seedM:cpd01581 3-Oxododecanoate
3-Oxododecanoic acid
3-oxo-dodecanoate
3-oxododecanoate
3-oxododecanoic acid
3oxdd
metacycM:3-OXODODECANOATE 3-oxo-dodecanoate
3-oxododecanoic acid
chebi:11873
chebi:1635
chebi:20167
chebi:20168
hmdb:HMDB10727
keggC:M_C02367
seedM:M_cpd01581
secondary/obsolete/fantasy identifier
hmdb:HMDB0010727 3-Oxododecanoic acid
3-Oxododecanoate
3-oxo-Dodecanoate
3-oxo-Dodecanoic acid
3-oxododecanoic acid