Feedback

4,4'-diaponeurosporenoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3175Image of MNXM3175
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 0
formulaC30H39O2
charge-1
mass431.62946
referencechebi:79064
InChIKeyNXJSQJIGCCIMAE-ORIYTCASSA-M
InChIInChI=1S/C30H40O2/c1-24(2)14-10-17-27(5)20-11-18-25(3)15-8-9-16-26(4)19-12-21-28(6)22-13-23-29(7)30(31)32/h8-9,11-16,18-23H,10,17H2,1-7H3,(H,31,32)/p-1/b9-8+,18-11+,19-12+,22-13+,25-15+,26-16+,27-20+,28-21+,29-23+
SMILESCC(C)=CCC\C(C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C=C(/C)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:79064
chebi:79064
4,4'-diaponeurosporenoate
(2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoate
CHEBI:80352
chebi:80352
kegg.compound:C16146
keggC:C16146
4,4'-Diaponeurosporenic acid
seed.compound:cpd14867
seedM:cpd14867
4,4'-Diaponeurosporenic acid
4,4'-diaponeurosporenoate
4,4'-diaponeurosporenoic acid
metacyc.compound:CPD-9913
metacycM:CPD-9913
4,4'-diaponeurosporenoate
4,4'-diaponeurosporenoic acid
CHEBI:83048
chebi:83048
4,4'-diaponeurosporenoic acid
(2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoic acid
keggC:M_C16146
seedM:M_cpd14867
secondary/obsolete/fantasy identifier