Feedback

4-methoxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3183Image of MNXM3183
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC8H7O3
charge-1
mass151.13938
referencechebi:16639
InChIKeyZEYHEAKUIGZSGI-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/p-1
SMILESCOc1ccc(cc1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16639
chebi:16639
4-methoxybenzoate
p-methoxybenzoate
seed.compound:cpd01658
seedM:cpd01658
4-Anisic acid
4-Methoxybenzoate
4-Methoxybenzoic acid
4-anisate
4-anisic acid
4-methoxybenzoate
4-methoxybenzoic acid
p-anisate
envipath:...dafe0f02aa56
envipathM:...dafe0f02aa56
4-Methoxybenzoate
kegg.compound:C02519
keggC:C02519
4-Methoxybenzoate
4-Anisic acid
4-Methoxybenzoic acid
sabiork.compound:2437
sabiorkM:2437
4-Methoxybenzoate
4-Anisic acid
4-Methoxybenzoic acid
p-Methoxybenzoate
metacyc.compound:CPD-1076
metacycM:CPD-1076
4-methoxybenzoate
4-anisate
4-anisic acid
4-methoxybenzoic acid
p-anisate
CHEBI:40813
chebi:40813
4-methoxybenzoic acid
4-Anisic acid
4-METHOXYBENZOIC ACID
4-Methoxybenzoic acid
anisic acid
draconic acid
p-anisic acid
p-methoxybenzoic acid
hmdb:HMDB0001101 p-Anisic acid
4-Anisate
4-Anisic acid
4-Anisic acid, 14C-carboxy
4-Anisic acid, copper (+2) salt
4-Anisic acid, potassium salt
4-Anisic acid, sodium salt
4-Methoxybenzoate
4-Methoxybenzoic acid
4-methoxybenzoic acid
Anisate
Anisic acid
Draconate
Draconic acid
P-Anisate
P-Methoxybenzoate
P-Methoxybenzoic acid
P-anisic acid
Para-anisic acid
hmdb:HMDB01101
chebi:12019
chebi:1889
chebi:20437
chebi:40807
keggC:M_C02519
seedM:M_cpd01658
secondary/obsolete/fantasy identifier