Feedback

5-acetamidopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3186Image of MNXM3186
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC7H12NO3
charge-1
mass158.17512
referencechebi:79193
InChIKeyTZZSWAXSIGWXOS-UHFFFAOYSA-M
InChIInChI=1S/C7H13NO3/c1-6(9)8-5-3-2-4-7(10)11/h2-5H2,1H3,(H,8,9)(H,10,11)/p-1
SMILESCC(=O)NCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:79193
chebi:79193
5-acetamidopentanoate
5-(acetylamino)pentanoate
5-acetamidovalerate
kegg.compound:C03087
keggC:C03087
5-Acetamidopentanoate
seed.compound:cpd01979
seedM:cpd01979
5-Acetamidopentanoate
5-acetamidopentanoate
5-acetamidovalerate
hmdb:HMDB0012175 5-Acetamidovalerate
5-Acetamidopentanoate
5-Acetamidopentanoic acid
5-acetamidopentanoic acid
lipidmaps:LMFA01030987
lipidmapsM:LMFA01030987
5-Acetamidovalerate
5-acetamidopentanoic acid
CHEBI:2024
chebi:2024
5-acetamidopentanoic acid
5-(acetylamino)pentanoic acid
metacyc.compound:5-ACETAMIDOVALERATE
metacycM:5-ACETAMIDOVALERATE
5-acetamidovalerate
5-acetamidopentanoate
hmdb:HMDB12175
keggC:M_C03087
seedM:M_cpd01979
secondary/obsolete/fantasy identifier