Feedback

5-pyridoxate

Properties
MNX_IDMNXM3190
formulaC8H8NO4
charge-1
mass182.15346
referencechebi:30960
Image of MNXM3190
InChIKeyVJZTVPVXKYQRJZ-UHFFFAOYSA-M
InChIInChI=1S/C8H9NO4/c1-4-7(11)6(3-10)5(2-9-4)8(12)13/h2,10-11H,3H2,1H3,(H,12,13)/p-1
SMILESCc1ncc(C([O-])=O)c(CO)c1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
envipath:...f3693c36e0c7 5-Pyridoxate
chebi:16409 5-pyridoxic acid
5-Pyridoxic acid
5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinecarboxylic acid
5-hydroxy-4-(hydroxymethyl)-6-methylnicotinic acid
5-hydroxy-4-(hydroxymethyl)-6-methylpyridine-3-carboxylic acid
metacycM:3-HYDROXY-ETCETERA-CARBOXYLATE 5-pyridoxate
3-hydroxy-4-hydroxymethyl-2-methylpyridine-5-carboxylate
chebi:30960 5-pyridoxate
3-Hydroxy-4-hydroxymethyl-2-methylpyridine-5-carboxylate
5-Pyridoxate
5-hydroxy-4-(hydroxymethyl)-6-methylnicotinate
5-hydroxy-4-(hydroxymethyl)-6-methylpyridine-3-carboxylate
seedM:cpd02901 5-Pyridoxate
3-Hydroxy-4-hydroxymethyl-2-methylpyridine-5-carboxylate
3-hydroxy-4-hydroxymethyl-2-methylpyridine-5-carboxylate
5-Pyridoxic acid
5-pyridoxate
keggC:C04773 3-Hydroxy-4-hydroxymethyl-2-methylpyridine-5-carboxylate
5-Pyridoxate
5-Pyridoxic acid
chebi:11815
chebi:1525
chebi:20044
chebi:20045
keggC:M_C04773
seedM:M_cpd02901
secondary/obsolete/fantasy identifier