Feedback

abacavir 5'-carboxylic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM3203Image of MNXM3203
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC14H15N6O2
charge-1
mass299.30814
referencechebi:64192
InChIKeyOCSMNHMMTKMVCP-APPZFPTMSA-M
InChIInChI=1S/C14H16N6O2/c15-14-18-11(17-8-2-3-8)10-12(19-14)20(6-16-10)9-4-1-7(5-9)13(21)22/h1,4,6-9H,2-3,5H2,(H,21,22)(H3,15,17,18,19)/p-1/t7-,9+/m1/s1
SMILESNc1nc(NC2CC2)c2ncn([C@@H]3C[C@@H](C=C3)C([O-])=O)c2n1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-2162081
reactomeM:R-ALL-2162081
CHEBI:64192
chebi:64192
abacavir 5'-carboxylic acid
(1S,4R)-4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]cyclopent-2-ene-1-carboxylic acid
5'-oxoabacavir
abacavir 5'-carboxylate
abacavir carboxylate
abacavir carboxylic acid