Feedback

acetylenedicarboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM3207Image of MNXM3207
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC4O4
charge-2
mass112.0404
referencechebi:15357
InChIKeyYTIVTFGABIZHHX-UHFFFAOYSA-L
InChIInChI=1S/C4H2O4/c5-3(6)1-2-4(7)8/h(H,5,6)(H,7,8)/p-2
SMILES[O-]C(=O)C#CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15357
chebi:15357
acetylenedicarboxylate
2-butynedioate
acetylenedicarboxylate(2-)
but-2-ynedioate
seed.compound:cpd02080
seedM:cpd02080
2-Butynedioic acid
2-butynedioic acid
Acetylenedicarboxylate
Acetylenedicarboxylic acid
acetylenedicarboxylate
acetylenedicarboxylic acid
kegg.compound:C03248
keggC:C03248
Acetylenedicarboxylate
2-Butynedioic acid
Acetylenedicarboxylic acid
CHEBI:30782
chebi:30782
acetylenedicarboxylate(1-)
3-carboxyprop-2-ynoate
metacyc.compound:CPD-1831
metacycM:CPD-1831
acetylenedicarboxylate
2-butynedioic acid
acetylenedicarboxylic acid
CHEBI:30781
chebi:30781
acetylenedicarboxylic acid
2-Butynedioic acid
Acetylenedicarboxylic acid
but-2-ynedioic acid
butynedioic acid
chebi:13716
chebi:19487
chebi:19488
chebi:22969
chebi:2420
keggC:M_C03248
seedM:M_cpd02080
secondary/obsolete/fantasy identifier