Feedback

acetylenedicarboxylate

Properties
MNX_IDMNXM3207
formulaC4O4
charge-2
mass112.0404
referencechebi:15357
Image of MNXM3207
InChIKeyYTIVTFGABIZHHX-UHFFFAOYSA-L
InChIInChI=1S/C4H2O4/c5-3(6)1-2-4(7)8/h(H,5,6)(H,7,8)/p-2
SMILES[O-]C(=O)C#CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:15357 acetylenedicarboxylate
2-butynedioate
acetylenedicarboxylate(2-)
but-2-ynedioate
chebi:30782 acetylenedicarboxylate(1-)
3-carboxyprop-2-ynoate
chebi:30781 acetylenedicarboxylic acid
2-Butynedioic acid
Acetylenedicarboxylic acid
but-2-ynedioic acid
butynedioic acid
chebi:13716
chebi:19487
chebi:19488
chebi:22969
chebi:2420
keggC:M_C03248
seedM:M_cpd02080
secondary/obsolete/fantasy identifier
metacycM:CPD-1831 acetylenedicarboxylate
2-butynedioic acid
acetylenedicarboxylic acid
keggC:C03248 Acetylenedicarboxylate
2-Butynedioic acid
Acetylenedicarboxylic acid
seedM:cpd02080 2-Butynedioic acid
2-butynedioic acid
Acetylenedicarboxylate
Acetylenedicarboxylic acid
acetylenedicarboxylate
acetylenedicarboxylic acid