Feedback

beta-D-fructose 2-phosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM3220Image of MNXM3220
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC6H11O9P
charge-2
mass258.119901
referencechebi:57267
InChIKeyPMTUDJVZIGZBIX-ZXXMMSQZSA-L
InChIInChI=1S/C6H13O9P/c7-1-3-4(9)5(10)6(2-8,14-3)15-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/p-2/t3-,4-,5+,6+/m1/s1
SMILESOC[C@H]1O[C@@](CO)(OP([O-])([O-])=O)[C@@H](O)[C@@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57267
chebi:57267
beta-D-fructose 2-phosphate
2-O-phosphonato-beta-D-fructofuranose
beta-D-fructofuranose 2-phosphate
beta-D-fructofuranose 2-phosphate(2-)
hmdb:HMDB0006800 Beta-D-Fructose 2-phosphate
2-O-phosphono-b-D-Fructofuranose
2-O-phosphono-beta-D-Fructofuranose
2-O-phosphono-beta-D-fructofuranose
2-phospho-b-D-Fructofuranose
2-phospho-beta-D-Fructofuranose
2-phospho-beta-D-fructofuranose
Fructofuranose 2-phosphate
Fructose-2-phosphate
b-D-Fructose 2-phosphate
b-D-Fructose 2-phosphoric acid
beta-D-Fructofuranose 2-phosphate
beta-D-Fructose 2-phosphoric acid
beta-D-fructose 2-phosphate
beta-D-fructose 2-phosphoric acid
fructose-2-phosphate
{[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}phosphonic acid
bigg.metabolite:f2p
biggM:f2p
Beta-D-fructose 2-phosphate
kegg.compound:C03267
keggC:C03267
beta-D-Fructose 2-phosphate
beta-D-Fructofuranose 2-phosphate
seed.compound:cpd02085
seedM:cpd02085
beta-D-Fructose 2-phosphate
beta-D-Fructofuranose 2-phosphate
beta-D-fructofuranose 2-phosphate
beta-D-fructose-2-phosphate
CHEBI:12350
chebi:12350
beta-D-fructofuranose 2-phosphate
2-O-phosphono-beta-D-fructofuranose
2-phospho-beta-D-fructofuranose
beta-D-Fructofuranose 2-phosphate
beta-D-Fructose 2-phosphate
beta-D-fructofuranose 2-(dihydrogen phosphate)
metacyc.compound:FRUCTOSE-2-PHOSPHATE
metacycM:FRUCTOSE-2-PHOSPHATE
beta-D-fructose-2-phosphate
beta-D-fructofuranose 2-phosphate
hmdb:HMDB06800
biggM:M_f2p
keggC:M_C03267
seedM:M_cpd02085
secondary/obsolete/fantasy identifier