Feedback

D-nopaline

PropertiesImageOccurences in reactions
MNX_IDMNXM3248Image of MNXM3248
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 1
formulaC11H19N4O6
charge-1
mass303.29192
referencechebi:58074
InChIKeyLMKYZBGVKHTLTN-NKWVEPMBSA-M
InChIInChI=1S/C11H20N4O6/c12-11(13)14-5-1-2-6(9(18)19)15-7(10(20)21)3-4-8(16)17/h6-7,15H,1-5H2,(H,16,17)(H,18,19)(H,20,21)(H4,12,13,14)/p-1/t6-,7+/m0/s1
SMILESNC(=[NH2+])NCCC[C@H]([NH2+][C@H](CCC([O-])=O)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58074
chebi:58074
D-nopaline
(2R)-2-{[(1S)-4-{[amino(iminio)methyl]amino}-1-carboxylatobutyl]azaniumyl}pentanedioate
D-nopalinate
D-nopalinate anion
D-nopalinate(1-)
bigg.metabolite:nop
biggM:nop
D-Nopaline
seed.compound:cpd01162
seedM:cpd01162
D-Nopaline
D-nopaline
N-[(1S)-4-Carbamimidamido-1-carboxybutyl]-D-glutamic acid
N-[4-[(Aminoiminomethyl)amino]-1-carboxybutyl]-D-glutamic acid(ECL)
N2-(D-1,3-Dicarboxypropyl)-L-arginine
N2-(D-1,3-dicarboxypropyl)-L-arginine
Nopaline
nop
CHEBI:17249
chebi:17249
D-nopaline
(2R)-2-{[(1S)-4-carbamimidamido-1-carboxybutyl]amino}pentanedioic acid
(S)-N-(4-((Aminoiminomethyl)amino)-1-carboxybutyl)-D-glutamic acid
D-Nopaline
N(2)-(D-1,3-dicarboxypropyl)-L-arginine
N-[(1S)-4-carbamimidamido-1-carboxybutyl]-D-glutamic acid
N-[4-[(Aminoiminomethyl)amino]-1-carboxybutyl]-D-glutamic acid(ECL)
N2-(D-1,3-Dicarboxypropyl)-L-arginine
Nopaline
metacyc.compound:CPD-308
metacycM:CPD-308
D-nopaline
N2-(D-1,3-dicarboxypropyl)-L-arginine
seed.compound:cpd05415
seedM:cpd05415
Nopaline
kegg.compound:C01682
keggC:C01682
Nopaline
D-Nopaline
N-[(1S)-4-Carbamimidamido-1-carboxybutyl]-D-glutamic acid
N2-(D-1,3-Dicarboxypropyl)-L-arginine
chebi:12630
chebi:21809
chebi:4216
chebi:7365
chebi:7620
biggM:M_nop
keggC:M_C01682
seedM:M_cpd01162
seedM:M_cpd05415
secondary/obsolete/fantasy identifier