Feedback

delphinidin

PropertiesImageOccurences in reactions
MNX_IDMNXM3256Image of MNXM3256
#reac
in my sandbox 0
in MNXref (generic)13
in models (compartimentalized) 3
formulaC15H9O7
charge-1
mass301.22776
referencechebi:144775
InChIKeyJKHRCGUTYDNCLE-UHFFFAOYSA-M
InChIInChI=1S/C15H10O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-5H,(H5-,16,17,18,19,20,21)/p-1
SMILESOc1cc([O-])c2cc([O-])c([o+]c2c1)-c1cc(O)c(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:144775
chebi:144775
delphinidin
7-hydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyran-1-ium-3,5-bis(olate)
7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenium-3,5-bis(olate)
delphinidin(1-)
lipidmaps:LMPK12010001
lipidmapsM:LMPK12010001
Delphinidin
sabiork.compound:8258
sabiorkM:8258
Delphinidin
3,3',4',5,5',7-Hexahydroxy-2-phenylbenzopyrylium chloride
3,3',4',5,5',7-Hexahydroxyflavylium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyryliumchlorid
Chlorure de 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium
Chlorure de3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium
Delfinidol chloride
Delphinidin chloride
Delphinidine
Delphinidol
Ephdine
IdB 1056
kegg.compound:C05908
keggC:C05908
Delphinidin
3,3',4',5,5',7-Hexahydroxy-2-phenylbenzopyrylium chloride
3,3',4',5,5',7-Hexahydroxyflavylium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyryliumchlorid
Chlorure de 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium
Delfinidol chloride
Delphinidin chloride
Delphinidine
Delphinidol
Ephdine
IdB 1056
seed.compound:cpd03505
seedM:cpd03505
Ephdine
3,3',4',5,5',7-Hexahydroxy-2-phenylbenzopyrylium chloride
3,3',4',5,5',7-Hexahydroxyflavylium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyryliumchlorid
Chlorure de 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium
Delfinidol chloride
Delphinidin
Delphinidin chloride
Delphinidine
Delphinidol
IdB 1056
delfinidin
delphinidin
CHEBI:28436
chebi:28436
delphinidin
3,3',4',5,5',7-Hexahydroxyflavylium
3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium
metacyc.compound:CPD-7090
metacycM:CPD-7090
delphinidin
delfinidin
chebi:23600
chebi:4382
keggC:M_C05908
seedM:M_cpd03505
secondary/obsolete/fantasy identifier