Feedback

dichlorochromopyrrolate

PropertiesImageOccurences in reactions
MNX_IDMNXM3261Image of MNXM3261
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 0
formulaC22H11Cl2N3O4
charge-2
mass452.24596
referencechebi:59198
InChIKeyOAMCCJASDLMTOO-UHFFFAOYSA-L
InChIInChI=1S/C22H13Cl2N3O4/c23-13-5-1-3-9-11(7-25-17(9)13)15-16(20(22(30)31)27-19(15)21(28)29)12-8-26-18-10(12)4-2-6-14(18)24/h1-8,25-27H,(H,28,29)(H,30,31)/p-2
SMILES[O-]C(=O)c1[nH]c(C([O-])=O)c(-c2c[nH]c3c(Cl)cccc23)c1-c1c[nH]c2c(Cl)cccc12
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:59198
chebi:59198
dichlorochromopyrrolate
3,4-bis(7-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate
kegg.compound:C19698
keggC:C19698
3,4-Bis(7-chloroindol-3-yl)pyrrole-2,5-dicarboxylate
Dichlorochromopyrrolate
seed.compound:cpd20946
seedM:cpd20946
3,4-Bis(7-chloroindol-3-yl)pyrrole-2,5-dicarboxylate
Dichlorochromopyrrolate
dichlorochromopyrrolate
dichlorochromopyrrolic acid
metacyc.compound:CPD-11754
metacycM:CPD-11754
dichlorochromopyrrolate
dichlorochromopyrrolic acid
CHEBI:59196
chebi:59196
dichlorochromopyrrolic acid
3,4-bis(7-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylic acid
keggC:M_C19698
seedM:M_cpd20946
secondary/obsolete/fantasy identifier