Feedback

dichlorochromopyrrolate

Properties
MNX_IDMNXM3261
formulaC22H11Cl2N3O4
charge-2
mass452.24596
referencechebi:59198
Image of MNXM3261
InChIKeyOAMCCJASDLMTOO-UHFFFAOYSA-L
InChIInChI=1S/C22H13Cl2N3O4/c23-13-5-1-3-9-11(7-25-17(9)13)15-16(20(22(30)31)27-19(15)21(28)29)12-8-26-18-10(12)4-2-6-14(18)24/h1-8,25-27H,(H,28,29)(H,30,31)/p-2
SMILES[O-]C(=O)c1[nH]c(C([O-])=O)c(-c2c[nH]c3c(Cl)cccc23)c1-c1c[nH]c2c(Cl)cccc12

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:M_C19698
seedM:M_cpd20946
secondary/obsolete/fantasy identifier
chebi:59198 dichlorochromopyrrolate
3,4-bis(7-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate
chebi:59196 dichlorochromopyrrolic acid
3,4-bis(7-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylic acid
keggC:C19698 3,4-Bis(7-chloroindol-3-yl)pyrrole-2,5-dicarboxylate
Dichlorochromopyrrolate
seedM:cpd20946 3,4-Bis(7-chloroindol-3-yl)pyrrole-2,5-dicarboxylate
Dichlorochromopyrrolate
dichlorochromopyrrolate
dichlorochromopyrrolic acid
metacycM:CPD-11754 dichlorochromopyrrolate
dichlorochromopyrrolic acid