Feedback

erythromycin B

Properties
MNX_IDMNXM3269
formulaC37H68NO12
charge1
mass718.93536
referencechebi:64279
Image of MNXM3269
InChIKeyIDRYSCOQVVUBIJ-PPGFLMPOSA-O
InChIInChI=1S/C37H67NO12/c1-14-26-20(4)29(40)21(5)28(39)18(2)16-36(9,44)33(50-35-30(41)25(38(11)12)15-19(3)46-35)22(6)31(23(7)34(43)48-26)49-27-17-37(10,45-13)32(42)24(8)47-27/h18-27,29-33,35,40-42,44H,14-17H2,1-13H3/p+1/t18-,19-,20+,21+,22+,23-,24+,25+,26-,27+,29+,30-,31+,32+,33-,35+,36-,37-/m1/s1
SMILESCC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)[NH+](C)C)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd04056 Erythromycin B
Berythromycin
erythromycin B
chebi:28196 erythromycin B
(3R,4S,5S,6R,7R,9R,11R,12S,13R,14R)-4-(2,6-dideoxy-3-C-methyl-3-O-methyl-alpha-L-ribo-hexopyranosyloxy)-14-ethyl-7,12-dihydroxy-6-[3,4,6-trideoxy-3-(dimethylamino)-beta-D-xylo-hexopyranosyloxy]-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione
12-deoxyerythromycin
Berythromycin
Erythromycin B
beritromicina
berythromycin
berythromycine
berythromycinum
metacycM:CPD-13805 erythromycin B
keggD:D03098 Berythromycin (USAN/INN)
Erythromycin B
chebi:64279 erythromycin B
(3R,4S,5S,6R,7R,9R,11R,12S,13R,14R)-4-(2,6-dideoxy-3-C-methyl-3-O-methyl-alpha-L-ribo-hexopyranosyloxy)-14-ethyl-7,12-dihydroxy-6-[3,4,6-trideoxy-3-(dimethylazaniumyl)-beta-D-xylo-hexopyranosyloxy]-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione
erythromycin B cation
erythromycin B(1+)
lipidmaps:LMPK04000012 Erythromycin B
keggC:C06653 Erythromycin B
Berythromycin
chebi:23949
chebi:4842
keggC:M_C06653
keggD:M_D03098
seedM:M_cpd04056
secondary/obsolete/fantasy identifier