Feedback

homovanillate

Properties
MNX_IDMNXM3287
formulaC9H9O4
charge-1
mass181.16536
referencechebi:133744
Image of MNXM3287
InChIKeyQRMZSPFSDQBLIX-UHFFFAOYSA-M
InChIInChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12)/p-1
SMILESCOc1cc(CC([O-])=O)ccc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-7651 homovanillate
3-methoxy-4-hydroxyphenylacetate
3-methoxy-4-hydroxyphenylacetic acid
4-hydroxy-3-methoxybenzenacetic acid
4-hydroxy-3-methoxyphenylacetic acid
homovanillic acid
vanillacetic acid
chebi:545959 homovanillic acid
(4-hydroxy-3-methoxyphenyl)acetic acid
2-(4-hydroxy-3-methoxyphenyl)acetic acid
3-Methoxy-4-hydroxyphenylacetate
3-Methoxy-4-hydroxyphenylacetic acid
4-Hydroxy-3-methoxybenzeneacetic acid
HVA
Homovanillic acid
Vanillacetic acid
keggC:C05582 Homovanillate
3-Methoxy-4-hydroxyphenylacetate
Homovanillic acid
chebi:133744 homovanillate
(4-hydroxy-3-methoxyphenyl)acetate
3-methoxy-4-hydroxyphenylacetate
hmdb:HMDB0000118 Homovanillic acid
(4-Hydroxy-3-methoxyphenyl)acetate
(4-Hydroxy-3-methoxyphenyl)acetic acid
2-(4-hydroxy-3-methoxyphenyl)acetic acid
3 Methoxy 4 hydroxyphenylacetic acid
3-Methoxy-4-hydroxy-phenylacetic acid
3-Methoxy-4-hydroxyphenylacetate
3-Methoxy-4-hydroxyphenylacetic acid
4 Hydroxy 3 methoxyphenylacetic acid
4-Hydroxy 3-methoxyphenylacetic acid
4-Hydroxy-3-methoxybenzeneacetate
4-Hydroxy-3-methoxybenzeneacetic acid
4-Hydroxy-3-methoxyphenylacetic acid
Acid, 3-methoxy-4-hydroxyphenylacetic
Acid, 4-hydroxy-3-methoxyphenylacetic
Acid, homovanillic
HVA
Homovanilate
Homovanilic acid
Homovanillate
Homovanillinic acid
Vanilacetate
Vanilacetic acid
Vanillacetate
Vanillacetic acid
homovanillic acid
seedM:cpd03312 Homovanillate
3-Methoxy-4-hydroxyphenylacetate
3-methoxy-4-hydroxyphenylacetate
3-methoxy-4-hydroxyphenylacetic acid
4-hydroxy-3-methoxybenzenacetic acid
4-hydroxy-3-methoxyphenylacetic acid
Homovanillic acid
homovanillate
homovanillic acid
vanillacetic acid
biggM:M_homoval
chebi:5758
hmdb:HMDB0004285
hmdb:HMDB00118
hmdb:HMDB04285
keggC:M_C05582
seedM:M_cpd03312
secondary/obsolete/fantasy identifier
biggM:homoval Homovanillate
MNXM162963is deprecated and replaced by this entry