Feedback

homovanillate

PropertiesImageOccurences in reactions
MNX_IDMNXM3287Image of MNXM3287
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 11
formulaC9H9O4
charge-1
mass181.05063
referencechebi:133744
InChIKeyQRMZSPFSDQBLIX-UHFFFAOYSA-M
InChIInChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12)/p-1
SMILESCOc1cc(CC(=O)[O-])ccc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:133744
chebi:133744
homovanillate
(4-hydroxy-3-methoxyphenyl)acetate
3-methoxy-4-hydroxyphenylacetate
bigg.metabolite:homoval
biggM:homoval
Homovanillate
seed.compound:cpd03312
seedM:cpd03312
Homovanillate
3-Methoxy-4-hydroxyphenylacetate
3-methoxy-4-hydroxyphenylacetate
3-methoxy-4-hydroxyphenylacetic acid
4-hydroxy-3-methoxybenzenacetic acid
4-hydroxy-3-methoxyphenylacetic acid
Homovanillic acid
homovanillate
homovanillic acid
vanillacetic acid
kegg.compound:C05582
keggC:C05582
Homovanillate
3-Methoxy-4-hydroxyphenylacetate
Homovanillic acid
hmdb:HMDB0000118 Homovanillic acid
(4-Hydroxy-3-methoxyphenyl)acetate
(4-Hydroxy-3-methoxyphenyl)acetic acid
2-(4-hydroxy-3-methoxyphenyl)acetic acid
3 Methoxy 4 hydroxyphenylacetic acid
3'-Methoxy-4'-hydroxyphenylacetic acid
3'-methoxy-4'-hydroxyphenylacetic acid
3-Methoxy-4-hydroxy-phenylacetic acid
3-Methoxy-4-hydroxyphenylacetate
3-Methoxy-4-hydroxyphenylacetic acid
4 Hydroxy 3 methoxyphenylacetic acid
4-Hydroxy 3-methoxyphenylacetic acid
4-Hydroxy-3-methoxybenzeneacetate
4-Hydroxy-3-methoxybenzeneacetic acid
4-Hydroxy-3-methoxyphenylacetic acid
Acid, 3-methoxy-4-hydroxyphenylacetic
Acid, 4-hydroxy-3-methoxyphenylacetic
Acid, homovanillic
HVA
Homovanilate
Homovanilic acid
Homovanillate
Homovanillinic acid
Vanilacetate
Vanilacetic acid
Vanillacetate
Vanillacetic acid
homovanillic acid
metacyc.compound:CPD-7651
metacycM:CPD-7651
homovanillate
3-methoxy-4-hydroxyphenylacetate
3-methoxy-4-hydroxyphenylacetic acid
4-hydroxy-3-methoxybenzenacetic acid
4-hydroxy-3-methoxyphenylacetic acid
homovanillic acid
vanillacetic acid
CHEBI:545959
chebi:545959
homovanillic acid
(4-hydroxy-3-methoxyphenyl)acetic acid
2-(4-hydroxy-3-methoxyphenyl)acetic acid
3-Methoxy-4-hydroxyphenylacetate
3-Methoxy-4-hydroxyphenylacetic acid
4-Hydroxy-3-methoxybenzeneacetic acid
HVA
Homovanillic acid
Vanillacetic acid
hmdb:HMDB0004285
hmdb:HMDB00118
hmdb:HMDB04285
chebi:5758
biggM:M_homoval
keggC:M_C05582
seedM:M_cpd03312
secondary/obsolete/fantasy identifier