Feedback

L-2-aminohexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3290Image of MNXM3290
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC6H13NO2
charge0
mass131.17296
referencechebi:58455
InChIKeyLRQKBLKVPFOOQJ-YFKPBYRVSA-N
InChIInChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1
SMILESCCCC[C@H]([NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58455
chebi:58455
L-2-aminohexanoate
(2S)-2-ammoniohexanoate
L-2-aminohexanoic acid zwitterion
L-norleucine zwitterion
lipidmaps:LMFA01100042
lipidmapsM:LMFA01100042
2S-amino-hexanoic acid
(S)-2-Aminohexanoic acid
2S-amino-hexanoic acid
CHEBI:21203
chebi:21203
L-2-aminohexanoate
(2S)-2-aminohexanoate
(S)-2-aminohexanoate
L-2-Aminohexanoate
L-Aminohexanoate
L-norleucinate
hmdb:HMDB0001645 L-Norleucine
(2S)-2-aminohexanoic acid
(S)-2-Aminohexanoate
(S)-2-Aminohexanoic acid
(S)-2-amino-Hexanoate
(S)-2-amino-Hexanoic acid
(S)-Aminohexanoate
(S)-Aminohexanoic acid
(S)-Norleucine
2-Aminocaproate
2-Aminocaproic acid
2-Aminohexanoate
2-Aminohexanoic acid
Caprine
Glycoleucine
L(+)-Norleucine
L-(+)-Norleucine
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
L-Isomer norleucine
Nle
Norleucine
Norleucine, L isomer
Norleucine, L-isomer
a-Aminocaproate
a-Aminocaproic acid
alpha-Aminocaproate
alpha-Aminocaproic acid
alpha-aminocaproate
alpha-aminocaproic acid
caprine
seed.compound:cpd01327
seedM:cpd01327
L-Norleucine
(S)-2-Aminohexanoic acid
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-2-aminohexanoate
L-2-aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
L-aminohexanoate
L-aminohexanoic acid
L-norleucine
kegg.compound:C01933
keggC:C01933
L-Norleucine
(S)-2-Aminohexanoic acid
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
sabiork.compound:2340
sabiorkM:2340
L-Norleucine
(S)-2-Aminohexanoic acid
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
Nle
CHEBI:18347
chebi:18347
L-norleucine
(2S)-2-aminohexanoic acid
(S)-2-Aminohexanoic acid
2-Aminocaproic acid
2-Aminohexanoic acid
Caprine
Glycoleucine
L(+)-norleucine
L-(+)-Norleucine
L-(+)-norleucine
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
L-Norleucine
NORLEUCINE
Nle
alpha-aminocaproic acid
norleucine
metacyc.compound:L-2-AMINOHEXANOATE
metacycM:L-2-AMINOHEXANOATE
L-norleucine
L-2-aminohexanoate
L-2-aminohexanoic acid
L-aminohexanoate
L-aminohexanoic acid
hmdb:HMDB01645
chebi:13055
chebi:21204
chebi:44357
chebi:44414
chebi:44556
chebi:6276
keggC:M_C01933
seedM:M_cpd01327
secondary/obsolete/fantasy identifier