Feedback

L-2-aminohexanoate

Properties
MNX_IDMNXM3290
formulaC6H13NO2
charge0
mass131.17296
referencechebi:58455
Image of MNXM3290
InChIKeyLRQKBLKVPFOOQJ-YFKPBYRVSA-N
InChIInChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1
SMILESCCCC[C@H]([NH3+])C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:18347 L-norleucine
(2S)-2-aminohexanoic acid
(S)-2-Aminohexanoic acid
2-Aminocaproic acid
2-Aminohexanoic acid
Caprine
Glycoleucine
L(+)-norleucine
L-(+)-Norleucine
L-(+)-norleucine
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
L-Norleucine
NORLEUCINE
Nle
alpha-aminocaproic acid
norleucine
sabiorkM:2340 L-Norleucine
(S)-2-Aminohexanoic acid
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
Nle
chebi:21203 L-2-aminohexanoate
(2S)-2-aminohexanoate
(S)-2-aminohexanoate
L-2-Aminohexanoate
L-Aminohexanoate
L-norleucinate
lipidmaps:LMFA01100042 2S-amino-hexanoic acid
(S)-2-Aminohexanoic acid
2S-amino-hexanoic acid
chebi:58455 L-2-aminohexanoate
(2S)-2-ammoniohexanoate
L-2-aminohexanoic acid zwitterion
L-norleucine zwitterion
keggC:C01933 L-Norleucine
(S)-2-Aminohexanoic acid
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
chebi:13055
chebi:21204
chebi:44357
chebi:44414
chebi:44556
chebi:6276
hmdb:HMDB01645
keggC:M_C01933
seedM:M_cpd01327
secondary/obsolete/fantasy identifier
metacycM:L-2-AMINOHEXANOATE L-norleucine
L-2-aminohexanoate
L-2-aminohexanoic acid
L-aminohexanoate
L-aminohexanoic acid
hmdb:HMDB0001645 L-Norleucine
(2S)-2-aminohexanoic acid
(S)-2-Aminohexanoate
(S)-2-Aminohexanoic acid
(S)-2-amino-Hexanoate
(S)-2-amino-Hexanoic acid
(S)-Aminohexanoate
(S)-Aminohexanoic acid
(S)-Norleucine
2-Aminocaproate
2-Aminocaproic acid
2-Aminohexanoate
2-Aminohexanoic acid
Caprine
Glycoleucine
L(+)-Norleucine
L-(+)-Norleucine
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
L-Isomer norleucine
Nle
Norleucine
Norleucine, L isomer
Norleucine, L-isomer
a-Aminocaproate
a-Aminocaproic acid
alpha-Aminocaproate
alpha-Aminocaproic acid
alpha-aminocaproate
alpha-aminocaproic acid
caprine
seedM:cpd01327 L-Norleucine
(S)-2-Aminohexanoic acid
L-2-Aminohexanoate
L-2-Aminohexanoic acid
L-2-aminohexanoate
L-2-aminohexanoic acid
L-Aminohexanoate
L-Aminohexanoic acid
L-aminohexanoate
L-aminohexanoic acid
L-norleucine