Feedback

D-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM331Image of MNXM331
#reac
in my sandbox 0
in MNXref (generic)39
in models (compartimentalized) 12
formulaC5H8NO4
charge-1
mass146.12136
referencechebi:29986
InChIKeyWHUUTDBJXJRKMK-GSVOUGTGSA-M
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m1/s1
SMILES[NH3+][C@H](CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29986
chebi:29986
D-glutamate
(2R)-2-ammoniopentanedioate
D-glutamate(1-)
D-glutamic acid monoanion
hydrogen D-glutamate
bigg.metabolite:glu__D
biggM:glu__D
D-Glutamate
sabiork.compound:1978
sabiorkM:1978
kegg.compound:C00217
keggC:C00217
D-Glutamate
D-2-Aminoglutaric acid
D-Glutamic acid
D-Glutaminic acid
seed.compound:cpd00186
seedM:cpd00186
D-Glutamate
D-2-Aminoglutaric acid
D-Glutamic acid
D-Glutaminic acid
D-glt
D-glu
D-glutamate
D-glutamic acid
glu-D
hmdb:HMDB0003339 D-Glutamic acid
(2R)-2-Aminopentanedioate
(2R)-2-Aminopentanedioic acid
(2R)-2-aminopentanedioic acid
(R)-2-Aminopentanedioate
(R)-2-Aminopentanedioic acid
Aluminum L glutamate
Aluminum L-glutamate
D Glutamate
D-2-Aminoglutarate
D-2-Aminoglutaric acid
D-2-Aminopentanedioate
D-2-Aminopentanedioic acid
D-Glutamate
D-Glutaminate
D-Glutaminic acid
D-Glutaminsaeure
D-glutamic acid
DGL
Glutamate
Glutamate D-form
Glutamate, potassium
Glutamic acid
Glutamic acid D-form
Glutamic acid, (D)-isomer
L Glutamate
L Glutamic acid
L-Glutamate
L-Glutamate, aluminum
L-Glutamic acid
Lopac-g-2128
Lopac-gamma-2128
Potassium glutamate
R-(-)-Glutamate
R-(-)-Glutamic acid
Tocris-0217
delta-2-Aminoglutarate
delta-2-Aminoglutaric acid
delta-2-Aminopentanedioate
delta-2-Aminopentanedioic acid
delta-Glutamate
delta-Glutamic acid
delta-Glutaminate
delta-Glutaminic acid
delta-Glutaminsaeure
CHEBI:29989
chebi:29989
D-glutamate(2-)
(2R)-2-aminopentanedioate
D-glutamate
D-glutamic acid dianion
metacyc.compound:D-GLT
metacycM:D-GLT
D-glutamate
D-glt
D-glu
D-glutamic acid
CHEBI:15966
chebi:15966
D-glutamic acid
(2R)-2-aminopentanedioic acid
(R)-2-aminopentanedioic acid
D-2-Aminoglutaric acid
D-Glutamic acid
D-Glutaminic acid
D-Glutaminsaeure
DGL
glutamic acid D-form
hmdb:HMDB03339
chebi:12979
chebi:21022
chebi:21023
chebi:4183
biggM:M_glu__D
keggC:M_C00217
seedM:M_cpd00186
secondary/obsolete/fantasy identifier