Feedback

N-methylanthranilate

Properties
MNX_IDMNXM3318
formulaC8H8NO2
charge-1
mass150.15466
referencechebi:36557
Image of MNXM3318
InChIKeyWVMBPWMAQDVZCM-UHFFFAOYSA-M
InChIInChI=1S/C8H9NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h2-5,9H,1H3,(H,10,11)/p-1
SMILESCNc1ccccc1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:16394 N-methylanthranilic acid
2-(Methylamino)benzoic acid
2-(methylamino)benzoic acid
N-Methyl-2-aminobenzoic acid
N-Methyl-o-aminobenzoic acid
N-Methylanthranilic acid
o-(Methylamino)benzoic acid
seedM:cpd01928 N-Methylanthranilate
2-(Methylamino)benzoic acid
2-(methylamino)benzoic acid
N-Methylanthranilic acid
N-methylanthranilate
N-methylanthranilic acid
keggC:C03005 N-Methylanthranilate
2-(Methylamino)benzoic acid
N-Methylanthranilic acid
chebi:36557 N-methylanthranilate
2-(methylamino)benzoate
N-Methylanthranilate
N-methyl-o-aminobenzoic acid
hmdb:HMDB0032609 2-(Methylamino)benzoic acid
2-(methylamino)-Benzoic acid
2-(methylamino)Benzoate
2-(methylamino)benzoic acid
N-Methyl-2-aminobenzoate
N-Methyl-2-aminobenzoic acid
N-Methyl-O-aminobenzoate
N-Methyl-O-aminobenzoic acid
N-Methyl-anthranilic acid
N-Methylanthranilic acid, 8ci
N-methylanthranilic acid
O-(methylamino)Benzoate
O-(methylamino)Benzoic acid
chebi:12606
chebi:19420
chebi:21762
chebi:7313
hmdb:HMDB32609
keggC:M_C03005
seedM:M_cpd01928
secondary/obsolete/fantasy identifier
metacycM:CPD-402 N-methylanthranilate
2-(methylamino)benzoic acid
N-methylanthranilic acid
MNXM474089is deprecated and replaced by this entry