Feedback

p-toluate

Properties
MNX_IDMNXM3331
formulaC8H7O2
charge-1
mass135.13998
referencechebi:28856
Image of MNXM3331
InChIKeyLPNBBFKOUUSUDB-UHFFFAOYSA-M
InChIInChI=1S/C8H8O2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H,9,10)/p-1
SMILESCc1ccc(cc1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:5590 Toluate
4-Methylbenzoate
4-Methylbenzoic acid
Crithminic acid
Toluenecarboxylic acid
p-Methylbenzoate
p-Toluate
p-Toluic acid
chebi:36635 p-toluic acid
4-Methylbenzoic acid
4-Toluic acid
4-methylbenzoic acid
Crithminic acid
Toluenecarboxylic acid
p-Carboxytoluene
p-Methylbenzoic acid
p-Toluic acid
p-Toluylic acid
para-Toluic acid
seedM:cpd01033 Toluate
4-Methylbenzoic acid
4-methylbenzoate
4-toluenecarboxylate
Crithminic acid
Toluenecarboxylic acid
p-Toluate
p-Toluic acid
p-tol
p-toluate
metacycM:4-TOLUENECARBOXYLATE 4-methylbenzoate
4-toluenecarboxylate
p-toluate
hmdb:HMDB0029635 4-Methylbenzoic acid
2420-97-5 (Cadmium salt)
4-Methyl-benzoic acid
4-Methylbenzoate
4-Toluate
4-Toluic acid
4-Toluic acid, barium salt
4-Toluic acid, cadmium salt
4-Toluic acid, calcium salt
4-Toluic acid, potassium salt
4-Toluic acid, zinc salt
4-methylbenzoic acid
Crithmic acid
Crithminate
Crithminic acid
P-Carboxytoluene
P-Methylbenzoate
P-Methylbenzoic acid
P-Toluate
P-Toluenecarboxylate
P-Toluic acid
P-Toluylate
P-Toluylic acid
Para-toluate
Para-toluic acid
Toluate
Toluenecarboxylate
Toluenecarboxylic acid
p-toluic acid
envipath:...e1b88f783071 p-Toluate
chebi:28856 p-toluate
4-methylbenzoate
4-toluenecarboxylate
Toluate
p-Toluate
keggC:C01454 Toluate
4-Methylbenzoic acid
Crithminic acid
Toluenecarboxylic acid
p-Toluate
p-Toluic acid
biggM:p_tol P-toluate
biggM:M_p_tol
chebi:20481
chebi:20482
chebi:47121
chebi:9623
hmdb:HMDB29635
keggC:M_C01454
seedM:M_cpd01033
secondary/obsolete/fantasy identifier
MNXM487283is deprecated and replaced by this entry