Feedback

paracetamol sulfate

PropertiesImageOccurences in reactions
MNX_IDMNXM3332Image of MNXM3332
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 5
formulaC8H9NO5S
charge0
mass231.02014
referencechebi:32635
InChIKeyIGTYILLPRJOVFY-UHFFFAOYSA-N
InChIInChI=1S/C8H9NO5S/c1-6(10)9-7-2-4-8(5-3-7)14-15(11,12)13/h2-5H,1H3,(H,9,10)(H,11,12,13)
SMILESCC(=O)Nc1ccc(OS(=O)(=O)O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-158472
reactomeM:R-ALL-158472
CHEBI:32635
chebi:32635
paracetamol sulfate
4-acetamidophenyl hydrogen sulfate
4-acetaminophen sulfate
N-(4-(sulfooxy)phenyl)acetamide
N-acetyl-4-aminophenol sulfate
acetaminophen sulfate
acetaminophen sulfate ester
hmdb:HMDB0059911 Paracetamol sulfate
(4-acetamidophenyl)oxidanesulfonic acid
4-Acetaminophen sulfate
4-Acetaminophen sulfuric acid
4-Acetaminophen sulphate
4-Acetaminophen sulphuric acid
Acetaminophen sulfate
Acetaminophen sulfate ester
Acetaminophen sulfate ester, monopotassium salt
Acetaminophen sulfuric acid
Acetaminophen sulfuric acid ester
Acetaminophen sulphate
Acetaminophen sulphate ester
Acetaminophen sulphuric acid
Acetaminophen sulphuric acid ester
Acetaminophen-sulfate
N-(4-(Sulfooxy)phenyl)acetamide
N-(4-(Sulphooxy)phenyl)acetamide
N-Acetyl-4-aminophenol sulfate
N-Acetyl-4-aminophenol sulfuric acid
N-Acetyl-4-aminophenol sulphate
N-Acetyl-4-aminophenol sulphuric acid
Paracetamol sulfuric acid
Paracetamol sulphate
Paracetamol sulphuric acid
acetaminophen sulfate
bigg.metabolite:sulpacmp
biggM:sulpacmp
Sulphate-conjugate-acetaminophen
hmdb:HMDB59911
biggM:M_sulpacmp
secondary/obsolete/fantasy identifier