Feedback

paracetamol sulfate

Properties
MNX_IDMNXM3332
formulaC8H9NO5S
charge0
mass231.2268
referencechebi:32635
Image of MNXM3332
InChIKeyIGTYILLPRJOVFY-UHFFFAOYSA-N
InChIInChI=1S/C8H9NO5S/c1-6(10)9-7-2-4-8(5-3-7)14-15(11,12)13/h2-5H,1H3,(H,9,10)(H,11,12,13)
SMILESCC(=O)Nc1ccc(OS(O)(=O)=O)cc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
biggM:M_sulpacmp
hmdb:HMDB59911
secondary/obsolete/fantasy identifier
hmdb:HMDB0059911 Paracetamol sulfate
(4-acetamidophenyl)oxidanesulfonic acid
4-Acetaminophen sulfate
4-Acetaminophen sulfuric acid
4-Acetaminophen sulphate
4-Acetaminophen sulphuric acid
Acetaminophen sulfate
Acetaminophen sulfate ester
Acetaminophen sulfate ester, monopotassium salt
Acetaminophen sulfuric acid
Acetaminophen sulfuric acid ester
Acetaminophen sulphate
Acetaminophen sulphate ester
Acetaminophen sulphuric acid
Acetaminophen sulphuric acid ester
Acetaminophen-sulfate
N-(4-(Sulfooxy)phenyl)acetamide
N-(4-(Sulphooxy)phenyl)acetamide
N-Acetyl-4-aminophenol sulfate
N-Acetyl-4-aminophenol sulfuric acid
N-Acetyl-4-aminophenol sulphate
N-Acetyl-4-aminophenol sulphuric acid
Paracetamol sulfuric acid
Paracetamol sulphate
Paracetamol sulphuric acid
acetaminophen sulfate
biggM:sulpacmp Sulphate-conjugate-acetaminophen
chebi:32635
reactome:R-ALL-158472
paracetamol sulfate
4-acetamidophenyl hydrogen sulfate
4-acetaminophen sulfate
N-(4-(sulfooxy)phenyl)acetamide
N-acetyl-4-aminophenol sulfate
acetaminophen sulfate
acetaminophen sulfate ester
MNXM90446is deprecated and replaced by this entry