Feedback

pelargonidin

PropertiesImageOccurences in reactions
MNX_IDMNXM3333Image of MNXM3333
#reac
in my sandbox 0
in MNXref (generic)15
in models (compartimentalized) 3
formulaC15H9O5
charge-1
mass269.22896
referencechebi:144777
InChIKeyXVFMGWDSJLBXDZ-UHFFFAOYSA-M
InChIInChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-7H,(H3-,16,17,18,19)/p-1
SMILESOc1ccc(cc1)-c1[o+]c2cc(O)cc([O-])c2cc1[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:144777
chebi:144777
pelargonidin
7-hydroxy-2-(4-hydroxyphenyl)-1-benzopyran-1-ium-3,5-bis(olate)
7-hydroxy-2-(4-hydroxyphenyl)chromenium-3,5-bis(olate)
pelargonidin(1-)
lipidmaps:LMPK12010003
lipidmapsM:LMPK12010003
Pelargonidin
seed.compound:cpd03501
seedM:cpd03501
Pelargonidin
1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride
3,4',5,7-Tetrahydroxyflavylium chloride
3,4',5,7-tetrahydroxyflavylium chloride
3,5,7-Trihydroxy-2-(4-hydroxyphenil)-1-benzopyrylium chloride
3,5,7-Trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride
3,5,7-trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride
Flavylium, 3,4',5,7-tetrahydroxy-, chloride
Pelargonidin chloride
Pelargonidol chloride
pelargonidin
sabiork.compound:8254
sabiorkM:8254
kegg.compound:C05904
keggC:C05904
Pelargonidin
3,4',5,7-Tetrahydroxyflavylium chloride
3,5,7-Trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride
Pelargonidin chloride
Pelargonidol chloride
metacyc.compound:PELARGONIDIN-CMPD
metacycM:PELARGONIDIN-CMPD
pelargonidin
CHEBI:25863
chebi:25863
pelargonidin
3,5,7-trihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium
3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromenylium
keggC:M_C05904
seedM:M_cpd03501
secondary/obsolete/fantasy identifier