Feedback

2,6,10,14-tetramethylpentadecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3342Image of MNXM3342
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 27
formulaC19H37O2
charge-1
mass297.2799
referencechebi:77268
InChIKeyPAHGJZDQXIOYTH-UHFFFAOYSA-M
InChIInChI=1S/C19H38O2/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(20)21/h15-18H,6-14H2,1-5H3,(H,20,21)/p-1
SMILESCC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77268
chebi:77268
2,6,10,14-tetramethylpentadecanoate
pristanate
bigg.metabolite:CE2416
biggM:CE2416
(2R,6S,10S)-pristanate
sabiork.compound:27782
sabiorkM:27782
Pristanate
bigg.metabolite:prist
biggM:prist
Pristanic acid
hmdb:HMDB0000795 Pristanic acid
(2S)-Pristanic acid
(2S,6R,10R)-2,6,10,14-Tetramethylpentadecanoate
(2S,6R,10R)-2,6,10,14-Tetramethylpentadecanoic acid
(2S,6R,10R)-Pristanic acid
2,6,10,14-Tetramethyl-pentadecansaeure
2,6,10,14-Tetramethylpentadecanoate
2,6,10,14-Tetramethylpentadecanoic acid
2,6,10,14-Tetramethylpentadecylate
2,6,10,14-Tetramethylpentadecylic acid
2,6,10,14-tetramethylpentadecanoic acid
Acide pristanique
Acido pristanico
Pristanate
Pristanate:(2S,6R,10R)-pristanate
Pristaninsaeure
pristanic acid
lipidmaps:LMPR0104010022
lipidmapsM:LMPR0104010022
Pristanic acid
2,6,10,14-Tetramethylpentadecanoic acid
2,6,10,14-tetramethyl-pentadecanoic acid
Pentadecanoic acid, 2,6,10,14-tetramethyl-
Pristanic acid
metacyc.compound:PRISTANATE
metacycM:PRISTANATE
seed.compound:cpd27807
seedM:cpd27807
pristanate
pristanic-acid
CHEBI:51340
chebi:51340
pristanic acid
2,6,10,14-Tetramethyl-pentadecansaeure
2,6,10,14-tetramethylpentadecanoic acid
2,6,10,14-tetramethylpentadecylic acid
Pristaninsaeure
acide pristanique
acido pristanico
hmdb:HMDB00795
biggM:M_CE2416
biggM:M_prist
seedM:M_cpd27807
secondary/obsolete/fantasy identifier