Feedback

1,2-dehydroreticuline

PropertiesImageOccurences in reactions
MNX_IDMNXM3351Image of MNXM3351
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC19H22NO4
charge1
mass328.38232
referencechebi:18363
InChIKeyZALYXKJOOUDZCC-UHFFFAOYSA-O
InChIInChI=1S/C19H21NO4/c1-20-7-6-13-10-19(24-3)17(22)11-14(13)15(20)8-12-4-5-18(23-2)16(21)9-12/h4-5,9-11H,6-8H2,1-3H3,(H-,21,22)/p+1
SMILESCOc1ccc(CC2=[N+](C)CCc3cc(OC)c(O)cc23)cc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18363
chebi:18363
1,2-dehydroreticuline
1,2-Dehydroreticuline
1,2-Dehydroreticulinium
3,4-Dihydro-7-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-(methyl-14C)-isoquinolinium
7-hydroxy-1-(3-hydroxy-4-methoxybenzyl)-6-methoxy-2-methyl-3,4-dihydroisoquinolinium
reticulinylium
seed.compound:cpd03680
seedM:cpd03680
1,2-Dehydroreticuline
1,2-Dehydroreticulinium
1,2-dehydroreticuline
1,2-dehydroreticulinium
3,4-Dihydro-7-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6- methoxy-2-(methyl-14C)-isoquinolinium
3,4-Dihydro-7-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-(methyl-14C)-isoquinolinium
reticulinylium
kegg.compound:C06167
keggC:C06167
1,2-Dehydroreticuline
1,2-Dehydroreticulinium
3,4-Dihydro-7-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-(methyl-14C)-isoquinolinium
metacyc.compound:12-DEHYDRORETICULINIUM
metacycM:12-DEHYDRORETICULINIUM
1,2-dehydroreticuline
reticulinylium
chebi:11143
chebi:18872
chebi:490
keggC:M_C06167
seedM:M_cpd03680
secondary/obsolete/fantasy identifier