Feedback

taurocyamine

PropertiesImageOccurences in reactions
MNX_IDMNXM3363Image of MNXM3363
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC3H9N3O3S
charge0
mass167.18798
referencechebi:58064
InChIKeyJKLRIMRKZBSSED-UHFFFAOYSA-N
InChIInChI=1S/C3H9N3O3S/c4-3(5)6-1-2-10(7,8)9/h1-2H2,(H4,4,5,6)(H,7,8,9)
SMILESNC(=[NH2+])NCCS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58064
chebi:58064
taurocyamine
2-{[amino(iminio)methyl]amino}ethanesulfonate
taurocyamine zwitterion
kegg.compound:C01959
keggC:C01959
Taurocyamine
hmdb:HMDB0003584 Taurocyamine
2-[(diaminomethylidene)amino]ethane-1-sulfonic acid
2-[(diaminomethylidene)amino]ethanesulfonic acid
2-{Carbamimidamido}ethanesulfonate
2-{Carbamimidamido}ethanesulfonic acid
2-{[amino(imino)methyl]amino}ethanesulfonate
2-{[amino(imino)methyl]amino}ethanesulfonic acid
2-{[amino(imino)methyl]amino}ethanesulphonate
2-{[amino(imino)methyl]amino}ethanesulphonic acid
Guanidinoethane sulfonate
Guanidinoethane sulfonic acid
Guanidinoethane sulphonate
Guanidinoethane sulphonic acid
Guanidinoethanesulfonate
Guanidinoethanesulfonic acid
Guanidinoethyl sulfonate
Guanodinoethane sulfonate
N-(Aminoiminomethyl) taurine
seed.compound:cpd01345
seedM:cpd01345
Taurocyamine
taurocyamine
metacyc.compound:TAUROCYAMINE
metacycM:TAUROCYAMINE
taurocyamine
CHEBI:17228
chebi:17228
taurocyamine
2-(carbamimidamido)ethanesulfonic acid
2-{[amino(imino)methyl]amino}ethanesulfonic acid
N-(aminoiminomethyl) taurine
Taurocyamine
guanidinoethane sulfonic acid
hmdb:HMDB03584
chebi:15198
chebi:26855
chebi:9409
keggC:M_C01959
seedM:M_cpd01345
secondary/obsolete/fantasy identifier