Feedback

thioglycolate

Properties
MNX_IDMNXM3370
formulaC2H3O2S
charge-1
mass91.11002
referencechebi:30066
Image of MNXM3370
InChIKeyCWERGRDVMFNCDR-UHFFFAOYSA-M
InChIInChI=1S/C2H4O2S/c3-2(4)1-5/h5H,1H2,(H,3,4)/p-1
SMILES[O-]C(=O)CS

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
biggM:thiog Thioglycolate
chebi:47869 thioglycolate(2-)
mercaptoacetic acid, ion(2-)
sulfidoacetate
sabiorkM:5993 Thioglycolate
2-Thioacetate
Mercaptoacetic acid
Mercaptoethanoic acid
Thioglycolic acid
seedM:cpd01415 Thioglycolate
Mercaptoacetic acid
Mercaptoethanoic acid
Thioglycolic acid
mercaptoacetate
mercaptoacetic acid
thiog
thioglycolate
thioglycolic acid
chebi:30066 thioglycolate
mercaptoacetate
sulfanylacetate
thioglycolate(1-)
thioglycollate
metacycM:THIOGLYCOLATE thioglycolate
mercaptoacetate
mercaptoacetic acid
thioglycolic acid
chebi:30065 thioglycolic acid
2-mercaptoacetic acid
2-thioglycolic acid
Mercaptoacetic acid
Mercaptoessigsaeure
Mercaptoethanoic acid
Merkaptoessigsaeure
SULFANYLACETIC ACID
Thioglycolic acid
Thioglykolsaeure
alpha-mercaptoacetic acid
sulfanylacetic acid
biggM:M_thiog
chebi:15236
chebi:26966
chebi:26967
chebi:9554
keggC:M_C02086
seedM:M_cpd01415
secondary/obsolete/fantasy identifier
keggC:C02086 Thioglycolate
Mercaptoacetic acid
Mercaptoethanoic acid
Thioglycolic acid