Feedback

thioglycolate

PropertiesImageOccurences in reactions
MNX_IDMNXM3370Image of MNXM3370
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 3
formulaC2H3O2S
charge-1
mass90.98592
referencechebi:30066
InChIKeyCWERGRDVMFNCDR-UHFFFAOYSA-M
InChIInChI=1S/C2H4O2S/c3-2(4)1-5/h5H,1H2,(H,3,4)/p-1
SMILESO=C([O-])CS
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30066
chebi:30066
thioglycolate
mercaptoacetate
sulfanylacetate
thioglycolate(1-)
thioglycollate
bigg.metabolite:thiog
biggM:thiog
Thioglycolate
sabiork.compound:5993
sabiorkM:5993
Thioglycolate
2-Thioacetate
Mercaptoacetic acid
Mercaptoethanoic acid
Thioglycolic acid
kegg.compound:C02086
keggC:C02086
Thioglycolate
Mercaptoacetic acid
Mercaptoethanoic acid
Thioglycolic acid
seed.compound:cpd01415
seedM:cpd01415
Thioglycolate
Mercaptoacetic acid
Mercaptoethanoic acid
Thioglycolic acid
mercaptoacetate
mercaptoacetic acid
thiog
thioglycolate
thioglycolic acid
CHEBI:47869
chebi:47869
thioglycolate(2-)
mercaptoacetic acid, ion(2-)
sulfidoacetate
metacyc.compound:THIOGLYCOLATE
metacycM:THIOGLYCOLATE
thioglycolate
mercaptoacetate
mercaptoacetic acid
thioglycolic acid
CHEBI:30065
chebi:30065
thioglycolic acid
2-mercaptoacetic acid
2-thioglycolic acid
Mercaptoacetic acid
Mercaptoessigsaeure
Mercaptoethanoic acid
Merkaptoessigsaeure
SULFANYLACETIC ACID
Thioglycolic acid
Thioglykolsaeure
alpha-mercaptoacetic acid
sulfanylacetic acid
chebi:15236
chebi:26966
chebi:26967
chebi:9554
biggM:M_thiog
keggC:M_C02086
seedM:M_cpd01415
secondary/obsolete/fantasy identifier