Feedback

pentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3382Image of MNXM3382
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 9
formulaC5H9O2
charge-1
mass101.12376
referencechebi:31011
InChIKeyNQPDZGIKBAWPEJ-UHFFFAOYSA-M
InChIInChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/p-1
SMILESCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-444051
reactomeM:R-ALL-444051
CHEBI:31011
chebi:31011
pentanoate
CH3-[CH2]3-COO(-)
n-propylacetate
pentanoic acid, ion(1-)
valerate
bigg.metabolite:pta
biggM:pta
Pentanoate
sabiork.compound:2161
sabiorkM:2161
kegg.compound:C00803
keggC:C00803
Pentanoate
Pentanoic acid
Valerate
Valerianic acid
Valeric acid
n-Pentanoate
n-Valeric acid
SLM:000389552
slm:000389552
Pentanoate
Valerate
seed.compound:cpd00597
seedM:cpd00597
Valerate
Pentanoate
Pentanoic acid
Valerianic acid
Valeric acid
n-Pentanoate
n-Valeric acid
pentanoate
pentanoic acid
pta
valerate
valerianic acid
bigg.metabolite:M03134
biggM:M03134
Valeric Acid
hmdb:HMDB0000892 Valeric acid
1-Butanecarboxylate
1-Butanecarboxylic acid
1-Pentanoate
1-Pentanoic acid
Butanecarboxylate
Butanecarboxylic acid
CH3-[CH2]3-COOH
Kyselina valerova
Lithium pentanoate
N-BuCOOH
N-C4H9COOH
N-Pentanoate
N-Pentanoic acid
N-Pentanoic acid, 11C-labeled
N-Pentanoic acid, 11C-labeled sodium salt
N-Pentanoic acid, ammonium salt
N-Pentanoic acid, maganese (+2) salt
N-Pentanoic acid, potassium salt
N-Pentanoic acid, sodium salt
N-Pentanoic acid, zinc salt
N-Valerate
N-Valeric acid
N-valeric acid
Pentanoate
Pentanoic acid
Pentoate
Pentoic acid
Propylacetate
Propylacetic acid
Valerate
Valerate, normal
Valerianate
Valerianic acid
Valeriansaeure
Valeriansaure
Valeric acid normal
Valeric acid, normal
pentanoic acid
lipidmaps:LMFA01010005
lipidmapsM:LMFA01010005
Valeric acid
C5:0
FA(5:0)
Pentanoic acid
Valerianic acid
envipath:...9bfbacbed726
envipathM:...9bfbacbed726
compound 38793
metacyc.compound:VALERATE
metacycM:VALERATE
pentanoate
pentanoic acid
valerate
valerianic acid
CHEBI:17418
chebi:17418
valeric acid
1-butanecarboxylic acid
CH3-[CH2]3-COOH
PENTANOIC ACID
Pentanoate
Pentanoic acid
Valerate
Valerianic acid
Valeriansaeure
Valeric acid
n-BuCOOH
n-Pentanoate
n-Valeric acid
n-pentanoic acid
n-valeric acid
pentanoic acid
pentoic acid
propylacetic acid
valeric acid, normal
hmdb:HMDB00892
chebi:113448
chebi:14751
chebi:25890
chebi:27263
chebi:27264
chebi:43606
chebi:44803
chebi:7980
biggM:M_M03134
biggM:M_pta
keggC:M_C00803
seedM:M_cpd00597
secondary/obsolete/fantasy identifier