Feedback

(S)-usnate

Properties
MNX_IDMNXM3387
formulaC18H14O7
charge-2
mass342.29956
referencechebi:57266
Image of MNXM3387
InChIKeyWEYVVCKOOFYHRW-GOSISDBHSA-L
InChIInChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,21-23H,1-4H3/p-2/t18-/m1/s1
SMILESCC(=O)C1=C([O-])C=C2Oc3c(c([O-])c(C)c(O)c3C(C)=O)[C@]2(C)C1=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:122 (-)-usnic acid
(-)-Usnic acid
(9bS)-2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzo[b,d]furan-1(9bH)-one
(S)-Usnic acid
(S)-usnate
keggC:M_C10101
seedM:M_cpd06990
secondary/obsolete/fantasy identifier
lipidmaps:LMPK13060002 (-)-Usnic acid
metacycM:CPD-7411 (S)-usnate
usnein
usniacin
usnic acid
usninsaeure
usno
chebi:57266 (S)-usnate
(-)-usnic acid(2-)
(9aS)-4,8-diacetyl-3-hydroxy-2,9a-dimethyl-9-oxo-9,9a-dihydrodibenzo[b,d]furan-1,7-diolate
keggC:C10101 (-)-Usnic acid
(S)-Usnate
(S)-Usnic acid
seedM:cpd06990 (S)-usnate
(-)-Usnic acid
(S)-Usnate
(S)-Usnic acid
usnein
usniacin
usnic acid
usninsaeure
usno