Feedback

(S)-usnate

PropertiesImageOccurences in reactions
MNX_IDMNXM3387Image of MNXM3387
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC18H14O7
charge-2
mass342.29956
referencechebi:57266
InChIKeyWEYVVCKOOFYHRW-GOSISDBHSA-L
InChIInChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,21-23H,1-4H3/p-2/t18-/m1/s1
SMILESCC(=O)C1=C([O-])C=C2Oc3c(c([O-])c(C)c(O)c3C(C)=O)[C@]2(C)C1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57266
chebi:57266
(S)-usnate
(-)-usnic acid(2-)
(9aS)-4,8-diacetyl-3-hydroxy-2,9a-dimethyl-9-oxo-9,9a-dihydrodibenzo[b,d]furan-1,7-diolate
lipidmaps:LMPK13060002
lipidmapsM:LMPK13060002
(-)-Usnic acid
kegg.compound:C10101
keggC:C10101
(-)-Usnic acid
(S)-Usnate
(S)-Usnic acid
CHEBI:122
chebi:122
(-)-usnic acid
(-)-Usnic acid
(9bS)-2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzo[b,d]furan-1(9bH)-one
(S)-Usnic acid
(S)-usnate
seed.compound:cpd06990
seedM:cpd06990
(S)-usnate
(-)-Usnic acid
(S)-Usnate
(S)-Usnic acid
usnein
usniacin
usnic acid
usninsaeure
usno
metacyc.compound:CPD-7411
metacycM:CPD-7411
(S)-usnate
usnein
usniacin
usnic acid
usninsaeure
usno
keggC:M_C10101
seedM:M_cpd06990
secondary/obsolete/fantasy identifier