Feedback

(3R,6R)-6-hydroxy-3-isopropenylheptanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3398Image of MNXM3398
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC10H17O3
charge-1
mass185.24018
referencechebi:64225
InChIKeyNQYDFAGFKCSWGI-RKDXNWHRSA-M
InChIInChI=1S/C10H18O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h8-9,11H,1,4-6H2,2-3H3,(H,12,13)/p-1/t8-,9-/m1/s1
SMILESC[C@@H](O)CC[C@H](CC([O-])=O)C(C)=C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:64225
chebi:64225
(3R,6R)-6-hydroxy-3-isopropenylheptanoate
(3R,6R)-6-hydroxy-3-(prop-1-en-2-yl)heptanoate
(3R,6R)-6-hydroxy-3-isopropenylheptanoate(1-)
seed.compound:cpd08258
seedM:cpd08258
CHEBI:204
chebi:204
kegg.compound:C11404
keggC:C11404
(3R)-6-Hydroxy-3-isopropenyl-heptanoate
metacyc.compound:CPD-10047
metacycM:CPD-10047
seed.compound:cpd22537
seedM:cpd22537
(3R,6R)-6-hydroxy-3-isopropenylheptanoate
CHEBI:64247
chebi:64247
(3R,6R)-6-hydroxy-3-isopropenylheptanoic acid
(3R,6R)-6-hydroxy-3-(prop-1-en-2-yl)heptanoic acid
seed.compound:cpd22185
seedM:cpd22185
6-Hydroxy-3-isopropenylheptanoates
CHEBI:64224
chebi:64224
6-hydroxy-3-isopropenylheptanoate
6-hydroxy-3-(prop-1-en-2-yl)heptanoate
6-hydroxy-3-isopropenylheptanoate(1-)
CHEBI:50452
chebi:50452
6-hydroxy-3-isopropenylheptanoic acid
6-hydroxy-3-(1-methylethenyl)enanthic acid
6-hydroxy-3-(1-methylethenyl)heptanoic acid
6-hydroxy-3-(prop-1-en-2-yl)heptanoic acid
6-hydroxy-3-isopropenylenanthic acid
lipidmaps:LMFA01050371
lipidmapsM:LMFA01050371
6-hydroxy-3-isopropenylheptanoic acid
6-hydroxy-3-(1-methylethenyl)heptanoic acid
6-hydroxy-3-(prop-1-en-2-yl)heptanoic acid
FA(10:1(OH))
metacyc.compound:6-Hydroxy-3-isopropenylheptanoates
metacycM:6-Hydroxy-3-isopropenylheptanoates
a 6-hydroxy-3-isopropenylheptanoate
keggC:M_C11404
seedM:M_cpd08258
seedM:M_cpd22185
seedM:M_cpd22537
secondary/obsolete/fantasy identifier