Feedback

(7R)-7-(4-carboxybutanamido)cephalosporanate

PropertiesImageOccurences in reactions
MNX_IDMNXM3402Image of MNXM3402
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC15H16N2O8S
charge-2
mass384.36222
referencechebi:58693
InChIKeyIXUSDMGLUJZNFO-BXUZGUMPSA-L
InChIInChI=1S/C15H18N2O8S/c1-7(18)25-5-8-6-26-14-11(13(22)17(14)12(8)15(23)24)16-9(19)3-2-4-10(20)21/h11,14H,2-6H2,1H3,(H,16,19)(H,20,21)(H,23,24)/p-2/t11-,14-/m1/s1
SMILESCC(=O)OCC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCC([O-])=O)C2=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58693
chebi:58693
(7R)-7-(4-carboxybutanamido)cephalosporanate
(6R,7R)-3-[(acetyloxy)methyl]-7-(4-carboxylatobutanamido)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
(7R)-7-(4-carboxylatobutanamido)cephalosporanate
sabiork.compound:23297
sabiorkM:23297
(7R)-7-(4-Carboxybutanamido)cephalosporanate
kegg.compound:C15666
keggC:C15666
(7R)-7-(4-Carboxybutanamido)cephalosporanate
7-Glutarylaminocephalosporanate
metacyc.compound:CPD-7270
metacycM:CPD-7270
(7R)-7-(4-carboxybutanamido)cephalosporanate
7-Glutarylaminocephalosporanate
CHEBI:41425
chebi:41425
(7R)-7-(4-carboxybutanamido)cephalosporanic acid
(6R,7R)-3-[(acetyloxy)methyl]-7-(4-carboxybutanamido)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
(7R)-7-(4-Carboxybutanamido)cephalosporanate
7-Glutarylaminocephalosporanate
7BETA-(4CARBOXYBUTANAMIDO) CEPHALOSPORANIC ACID
Gl-7-Aca
Glutaryl-7-aca
Glutaryl-7-aminocephalosporanic acid
seed.compound:cpd11309
seedM:cpd11309
7-Glutarylaminocephalosporanate
(7R)-7-(4-Carboxybutanamido)cephalosporanate
(7R)-7-(4-carboxybutanamido)cephalosporanate
keggC:M_C15666
seedM:M_cpd11309
secondary/obsolete/fantasy identifier