Feedback

D-gluconate

PropertiesImageOccurences in reactions
MNX_IDMNXM341Image of MNXM341
#reac
in my sandbox 0
in MNXref (generic)39
in models (compartimentalized) 34
formulaC6H11O7
charge-1
mass195.05103
referencechebi:18391
InChIKeyRGHNJXZEOKUKBD-SQOUGZDYSA-M
InChIInChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1
SMILESO=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18391
chebi:18391
D-gluconate
2,3,4,5,6-pentahydroxyhexanoate
Dextronate
Glycogenate
Glyconate
Maltonate
bigg.metabolite:glcn__D
biggM:glcn__D
D Gluconate
bigg.metabolite:glcn
biggM:glcn
D-Gluconate
sabiork.compound:1998
sabiorkM:1998
D-Gluconate
D-Gluco-hexonic acid
D-Gluconic acid
D-gluco-Hexonic acid
kegg.compound:C00257
keggC:C00257
D-Gluconic acid
D-Gluconate
D-gluco-Hexonic acid
metacyc.compound:GLUCONATE
metacycM:GLUCONATE
D-gluconate
D-gluconic acid
dextronic acid
maltonic acid
CHEBI:33198
chebi:33198
D-gluconic acid
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
D-Gluconic acid
D-Gluconsaeure
D-Glukonsaeure
D-gluco-Hexonic acid
Dextronic acid
GLUCONIC ACID
Gluconic acid
Glycogenic acid
Hexonic acid
Maltonic acid
seed.compound:cpd00222
seedM:cpd00222
GLCN
D-Gluconate
D-Gluconic acid
D-gluco-Hexonic acid
D-gluconate
D-gluconic acid
aldonic acid
dextronic acid
glcn
gluconate
gluconic acid
maltonic acid
sabiork.compound:23420
sabiorkM:23420
Gluconate
hmdb:HMDB0000625 Gluconic acid
(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoate
(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoic acid
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
2,3,4,5,6-Pentahydroxy-hexanoate
2,3,4,5,6-Pentahydroxy-hexanoic acid
2,3,4,5,6-Pentahydroxyhexanoate
2,3,4,5,6-Pentahydroxyhexanoic acid
Boron gluconate
D-Gluco-hexonate
D-Gluco-hexonic acid
D-Gluconate
D-Gluconic acid
D-Gluconsaeure
D-Glukonsaeure
Dextronate
Dextronic acid
GCO
Glosanto
Gluconate
Gluconic acid, (113)indium-labeled
Gluconic acid, (14)C-labeled
Gluconic acid, (159)dysprosium-labeled salt
Gluconic acid, (99)technecium (5+) salt
Gluconic acid, 1-(14)C-labeled
Gluconic acid, 6-(14)C-labeled
Gluconic acid, aluminum (3:1) salt
Gluconic acid, ammonium salt
Gluconic acid, calcium salt
Gluconic acid, cesium(+3) salt
Gluconic acid, cobalt (2:1) salt
Gluconic acid, copper salt
Gluconic acid, fe(+2) salt, dihydrate
Gluconic acid, lanthanum(+3) salt
Gluconic acid, magnesium (2:1) salt
Gluconic acid, manganese (2:1) salt
Gluconic acid, monolithium salt
Gluconic acid, monopotassium salt
Gluconic acid, monosodium salt
Gluconic acid, potassium salt
Gluconic acid, sodium salt
Gluconic acid, strontium (2:1) salt
Gluconic acid, tin(+2) salt
Gluconic acid, zinc salt
Glycogenate
Glycogenic acid
Glyconate
Glyconic acid
Hexonate
Hexonic acid
Lithium gluconate
Magnerot
Magnesium gluconate
Maltonate
Maltonic acid
Manganese gluconate
Pentahydroxycaproate
Pentahydroxycaproic acid
Sodium gluconate
Zinc gluconate
gluconate
CHEBI:24265
chebi:24265
gluconate
CHEBI:24266
chebi:24266
gluconic acid
hmdb:HMDB0003373
hmdb:HMDB00625
hmdb:HMDB03373
chebi:12955
chebi:20983
chebi:20985
chebi:20986
chebi:4157
chebi:42715
biggM:M_glcn
biggM:M_glcn__D
keggC:M_C00257
seedM:M_cpd00222
secondary/obsolete/fantasy identifier