Feedback

1,6-bis-O-galloyl-beta-D-glucose

PropertiesImageOccurences in reactions
MNX_IDMNXM3418Image of MNXM3418
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC20H20O14
charge0
mass484.3644
referencechebi:15723
InChIKeyLYGRISUQIZNHGM-IVABAYMNSA-N
InChIInChI=1S/C20H20O14/c21-8-1-6(2-9(22)13(8)25)18(30)32-5-12-15(27)16(28)17(29)20(33-12)34-19(31)7-3-10(23)14(26)11(24)4-7/h1-4,12,15-17,20-29H,5H2/t12-,15-,16+,17-,20+/m1/s1
SMILESO[C@H]1[C@H](O)[C@@H](COC(=O)c2cc(O)c(O)c(O)c2)O[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15723
chebi:15723
1,6-bis-O-galloyl-beta-D-glucose
1,6-bis-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose
1-O,6-O-Digalloyl-beta-D-glucose
1-O,6-O-digalloyl-beta-D-glucose
kegg.compound:C04101
keggC:C04101
1-O,6-O-Digalloyl-beta-D-glucose
seed.compound:cpd02532
seedM:cpd02532
1-O,6-O-Digalloyl-beta-D-glucose
1-O,6-O-digalloyl-beta-D-glucose
3,4,5-trihydroxybenzoic acid [3,4,5-trihydroxy-6-(3,4,5- trihydroxybenzoyl)oxy-tetrahydropyran-2-yl]methyl ester
metacyc.compound:1-O6-O-DIGALLOYL-BETA-D-GLUCOSE
metacycM:1-O6-O-DIGALLOYL-BETA-D-GLUCOSE
1-O,6-O-digalloyl-beta-D-glucose
3,4,5-trihydroxybenzoic acid [3,4,5-trihydroxy-6-(3,4,5- trihydroxybenzoyl)oxy-tetrahydropyran-2-yl]methyl ester
chebi:11211
chebi:18977
chebi:650
keggC:M_C04101
seedM:M_cpd02532
secondary/obsolete/fantasy identifier