Feedback

2,2-bis(4-hydroxyphenyl)-1-propanol

PropertiesImageOccurences in reactions
MNX_IDMNXM3436Image of MNXM3436
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC15H16O3
charge0
mass244.28574
referencechebi:33613
InChIKeyHHOUSCIEKLBSGQ-UHFFFAOYSA-N
InChIInChI=1S/C15H16O3/c1-15(10-16,11-2-6-13(17)7-3-11)12-4-8-14(18)9-5-12/h2-9,16-18H,10H2,1H3
SMILESCC(CO)(c1ccc(O)cc1)c1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:33613
chebi:33613
2,2-bis(4-hydroxyphenyl)-1-propanol
2,2-Bis(4-hydroxyphenyl)-1-propanol
2,2-bis(4-hydroxyphenyl)propan-1-ol
4,4'-(1-hydroxypropane-2,2-diyl)diphenol
seed.compound:cpd09482
seedM:cpd09482
kegg.compound:C13631
keggC:C13631
2,2-Bis(4-hydroxyphenyl)-1-propanol
envipath:...4feb458030e5
envipathM:...4feb458030e5
2,2-bis(4-Hydroxyphenyl)-1-propanol
chebi:19286
chebi:31066
keggC:M_C13631
seedM:M_cpd09482
secondary/obsolete/fantasy identifier