Feedback

2-(2-methylsulfanyl)ethylmalate

PropertiesImageOccurences in reactions
MNX_IDMNXM3441Image of MNXM3441
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC7H10O5S
charge-2
mass206.2173
referencechebi:58816
InChIKeyFZNWJRXTACKOPU-UHFFFAOYSA-L
InChIInChI=1S/C7H12O5S/c1-13-3-2-7(12,6(10)11)4-5(8)9/h12H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2
SMILESCSCCC(O)(CC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58816
chebi:58816
2-(2-methylsulfanyl)ethylmalate
2-(2-methylthioethyl)malate(2-)
2-hydroxy-2-[2-(methylsulfanyl)ethyl]butanedioate
2-hydroxy-2-[2-(methylsulfanyl)ethyl]succinate
seed.compound:cpd17400
seedM:cpd17400
2-(2'-Methylthio)ethylmalate
2-(2'-Methylthio)ethylmalic acid
2-(2'-methylthio)ethylmalic-acid
2-[(2'-methylsulfanyl)ethyl]malate
2-[(2'-methylthio)ethyl]malate
2-[(2'-methylthio)ethyl]malic-acid
kegg.compound:C17210
keggC:C17210
2-(2'-Methylthio)ethylmalic acid
2-(2'-Methylthio)ethylmalate
CHEBI:50261
chebi:50261
2-(2-methylthioethyl)malic acid
2-(2'-Methylthio)ethylmalate
2-hydroxy-2-[2-(methylsulfanyl)ethyl]butanedioic acid
MTEM
metacyc.compound:2-2-METHYLTHIOETHYLMALIC-ACID
metacycM:2-2-METHYLTHIOETHYLMALIC-ACID
2-[(2'-methylsulfanyl)ethyl]malate
2-[(2'-methylthio)ethyl]malate
2-[(2'-methylthio)ethyl]malic-acid
keggC:M_C17210
seedM:M_cpd17400
secondary/obsolete/fantasy identifier